EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C61H58N14O18S5 |
| Net Charge | 0 |
| Average Mass | 1435.550 |
| Monoisotopic Mass | 1434.26571 |
| SMILES | [H][C@]1(O[C@@H]2C(=O)OCc3cccc4c3c3c(n4O)C(=O)OC[C@@H]4NC(=O)c5csc(n5)[C@@H](NC(=O)c5csc(n5)/C(=C(/C)OC)NC(=O)[C@H]([C@@H](C)O)NC(=O)c5csc(n5)-c5cc(O)c(-c6nc(C(=O)NC(=C)C(N)=O)cs6)nc5-c5csc4n5)[C@@H]2OC3)C[C@]2(C)OCN(C)[C@]2([H])[C@H](C)O1 |
| InChI | InChI=1S/C61H58N14O18S5/c1-22(48(62)78)63-49(79)31-18-97-57(68-31)42-36(77)11-27-41(70-42)30-16-95-55(65-30)29-15-90-59(84)44-28-14-88-45(46(60(85)89-13-26-9-8-10-35(38(26)28)75(44)86)93-37-12-61(5)47(25(4)92-37)74(6)21-91-61)43(58-69-32(19-98-58)50(80)64-29)73-52(82)34-20-96-56(67-34)40(24(3)87-7)72-53(83)39(23(2)76)71-51(81)33-17-94-54(27)66-33/h8-11,16-20,23,25,29,37,39,43,45-47,76-77,86H,1,12-15,21H2,2-7H3,(H2,62,78)(H,63,79)(H,64,80)(H,71,81)(H,72,83)(H,73,82)/b40-24+/t23-,25+,29+,37+,39+,43+,45+,46+,47-,61+/m1/s1 |
| InChIKey | GYOHFSLEKIIJMU-UMNFMQIXSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Amycolatopsis fastidiosa (ncbitaxon:1816) | - | PubMed (17917239) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thiazomycin (CHEBI:66219) has role antibacterial agent (CHEBI:33282) |
| thiazomycin (CHEBI:66219) has role antimicrobial agent (CHEBI:33281) |
| thiazomycin (CHEBI:66219) has role bacterial metabolite (CHEBI:76969) |
| thiazomycin (CHEBI:66219) is a heterodetic cyclic peptide (CHEBI:24533) |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12681378 | Reaxys |
| Citations |
|---|