EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H32O6 |
| Net Charge | 0 |
| Average Mass | 464.558 |
| Monoisotopic Mass | 464.21989 |
| SMILES | CC(C)=CCc1c(O)c(O)c2oc3c(CC=C(C)C)c(O)cc(O)c3c(=O)c2c1CC=C(C)C |
| InChI | InChI=1S/C28H32O6/c1-14(2)7-10-17-18(11-8-15(3)4)24(31)26(33)28-22(17)25(32)23-21(30)13-20(29)19(27(23)34-28)12-9-16(5)6/h7-9,13,29-31,33H,10-12H2,1-6H3 |
| InChIKey | HAHRYXGQWSJKPI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Garcinia xanthochymus (ncbitaxon:198766) | xylem (BTO:0001468) | PubMed (14600386) | Previous component: wood; |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. nerve growth factor stimulator Any molecule shown to have the potentiality in stimulating the effect of nerve growth factor. |
| Application: | nerve growth factor stimulator Any molecule shown to have the potentiality in stimulating the effect of nerve growth factor. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,3,5,6-tetrahydroxy-4,7,8-tri(3-methyl-2-butenyl)xanthone (CHEBI:66213) has role metabolite (CHEBI:25212) |
| 1,3,5,6-tetrahydroxy-4,7,8-tri(3-methyl-2-butenyl)xanthone (CHEBI:66213) has role nerve growth factor stimulator (CHEBI:72294) |
| 1,3,5,6-tetrahydroxy-4,7,8-tri(3-methyl-2-butenyl)xanthone (CHEBI:66213) is a phenols (CHEBI:33853) |
| 1,3,5,6-tetrahydroxy-4,7,8-tri(3-methyl-2-butenyl)xanthone (CHEBI:66213) is a xanthones (CHEBI:51149) |
| IUPAC Name |
|---|
| 3,4,6,8-tetrahydroxy-1,2,5-tris(3-methylbut-2-en-1-yl)-9H-xanthen-9-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9599599 | Reaxys |
| Citations |
|---|