EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O10 |
| Net Charge | 0 |
| Average Mass | 450.440 |
| Monoisotopic Mass | 450.15260 |
| SMILES | O=C(Cc1ccc(O)c(O)c1)O[C@H]1[C@H](OCCc2ccc(O)cc2)O[C@H](CO)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H26O10/c23-11-17-19(28)20(29)21(32-18(27)10-13-3-6-15(25)16(26)9-13)22(31-17)30-8-7-12-1-4-14(24)5-2-12/h1-6,9,17,19-26,28-29H,7-8,10-11H2/t17-,19-,20+,21-,22-/m1/s1 |
| InChIKey | KCKBTWNNYSDHSE-MIUGBVLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ternstroemia japonica (ncbitaxon:931930) | leaf (BTO:0000713) | PubMed (17067150) | Fresh leaves |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ternstroside E (CHEBI:66207) has role antioxidant (CHEBI:22586) |
| ternstroside E (CHEBI:66207) has role metabolite (CHEBI:25212) |
| ternstroside E (CHEBI:66207) is a carboxylic ester (CHEBI:33308) |
| ternstroside E (CHEBI:66207) is a catechols (CHEBI:33566) |
| ternstroside E (CHEBI:66207) is a monosaccharide derivative (CHEBI:63367) |
| ternstroside E (CHEBI:66207) is a phenylethanoid (CHEBI:74644) |
| ternstroside E (CHEBI:66207) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-(4-hydroxyphenyl)ethyl 2-O-[(3,4-dihydroxyphenyl)acetyl]-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 2-(4-hydroxyphenyl)ethyl 2-O-(3,4-dihydroxyphenylethanoyl)-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18608189 | Reaxys |
| Citations |
|---|