EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H26O11 |
| Net Charge | 0 |
| Average Mass | 466.439 |
| Monoisotopic Mass | 466.14751 |
| SMILES | O=C(Cc1ccc(O)c(O)c1)OC[C@H]1O[C@@H](OCCc2ccc(O)c(O)c2)[C@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C22H26O11/c23-13-3-1-11(7-15(13)25)5-6-31-22-21(30)20(29)19(28)17(33-22)10-32-18(27)9-12-2-4-14(24)16(26)8-12/h1-4,7-8,17,19-26,28-30H,5-6,9-10H2/t17-,19-,20+,21-,22-/m1/s1 |
| InChIKey | UYICXCOMJPCYON-MIUGBVLSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ternstroemia japonica (ncbitaxon:931930) | leaf (BTO:0000713) | PubMed (17067150) | Fresh leaves |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ternstroside D (CHEBI:66206) has role antioxidant (CHEBI:22586) |
| ternstroside D (CHEBI:66206) has role metabolite (CHEBI:25212) |
| ternstroside D (CHEBI:66206) is a carboxylic ester (CHEBI:33308) |
| ternstroside D (CHEBI:66206) is a catechols (CHEBI:33566) |
| ternstroside D (CHEBI:66206) is a monosaccharide derivative (CHEBI:63367) |
| ternstroside D (CHEBI:66206) is a phenylethanoid (CHEBI:74644) |
| ternstroside D (CHEBI:66206) is a β-D-glucoside (CHEBI:22798) |
| IUPAC Name |
|---|
| 2-(3,4-dihydroxyphenyl)ethyl 6-O-[(3,4-dihydroxyphenyl)acetyl]-β-D-glucopyranoside |
| Synonym | Source |
|---|---|
| 2-(3,4-dihydroxyphenyl)ethyl-6-O-(3,4-dihydroxyphenylethanoyl)-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18608192 | Reaxys |
| Citations |
|---|