EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H18O3 |
| Net Charge | 0 |
| Average Mass | 294.350 |
| Monoisotopic Mass | 294.12559 |
| SMILES | C=C(Cc1ccc(O)cc1)C(=C)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H18O3/c1-13(9-15-3-6-17(20)7-4-15)14(2)10-16-5-8-18-19(11-16)22-12-21-18/h3-8,11,20H,1-2,9-10,12H2 |
| InChIKey | OUIGYUDPNSGJSX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Terminalia sericea (ncbitaxon:459862) | root (BTO:0001188) | PubMed (18484533) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| termilignan B (CHEBI:66202) has role antibacterial agent (CHEBI:33282) |
| termilignan B (CHEBI:66202) has role plant metabolite (CHEBI:76924) |
| termilignan B (CHEBI:66202) is a benzodioxoles (CHEBI:38298) |
| termilignan B (CHEBI:66202) is a olefinic compound (CHEBI:78840) |
| termilignan B (CHEBI:66202) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 4-[3-(1,3-benzodioxol-5-ylmethyl)-2-methylidenebut-3-en-1-yl]phenol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18567976 | Reaxys |
| Citations |
|---|