EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O5 |
| Net Charge | 0 |
| Average Mass | 352.386 |
| Monoisotopic Mass | 352.13107 |
| SMILES | [H][C@]12Oc3ccc(C(=O)/C=C/c4ccccc4)c(O)c3[C@@]1([H])[C@H](O)C(C)(C)O2 |
| InChI | InChI=1S/C21H20O5/c1-21(2)19(24)17-16-15(25-20(17)26-21)11-9-13(18(16)23)14(22)10-8-12-6-4-3-5-7-12/h3-11,17,19-20,23-24H,1-2H3/b10-8+/t17-,19-,20+/m0/s1 |
| InChIKey | BIKNREOOENVYGF-ZLMOQVSZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tephrosia purpurea (ncbitaxon:228354) | - | PubMed (10814365) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-tephrosone (CHEBI:66201) has role antineoplastic agent (CHEBI:35610) |
| (+)-tephrosone (CHEBI:66201) has role plant metabolite (CHEBI:76924) |
| (+)-tephrosone (CHEBI:66201) is a chalcones (CHEBI:23086) |
| (+)-tephrosone (CHEBI:66201) is a cyclic ether (CHEBI:37407) |
| (+)-tephrosone (CHEBI:66201) is a organic heterotricyclic compound (CHEBI:26979) |
| (+)-tephrosone (CHEBI:66201) is a phenols (CHEBI:33853) |
| (+)-tephrosone (CHEBI:66201) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (2E)-1-[(3S,3aS,8aR)-3,4-dihydroxy-2,2-dimethyl-2,3,3a,8a-tetrahydrofuro[2,3-b][1]benzofuran-5-yl]-3-phenylprop-2-en-1-one |
| Synonym | Source |
|---|---|
| (+)-(2''R,3''S,4''S)-[2'',3''-b]-dihydrofurano-5'',5''-dimethyl[4',5'-h]-6'-hydroxy-4''-tetrahydrofuranohydroxychalcone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12120208 | LIPID MAPS |
| Citations |
|---|