EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H28O6 |
| Net Charge | 0 |
| Average Mass | 484.548 |
| Monoisotopic Mass | 484.18859 |
| SMILES | [H][C@]1(c2c(O)ccc3c2O[C@H](c2ccccc2)CC3=O)COC(C)(C)[C@@]1([H])OC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C30H28O6/c1-30(2)29(36-26(33)16-13-19-9-5-3-6-10-19)22(18-34-30)27-23(31)15-14-21-24(32)17-25(35-28(21)27)20-11-7-4-8-12-20/h3-16,22,25,29,31H,17-18H2,1-2H3/b16-13+/t22-,25+,29+/m1/s1 |
| InChIKey | QBEVDWJGVNNOGT-NTWNTOQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tephrosia purpurea (ncbitaxon:228354) | - | PubMed (10814365) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-tephrorin B (CHEBI:66200) has role antineoplastic agent (CHEBI:35610) |
| (+)-tephrorin B (CHEBI:66200) has role plant metabolite (CHEBI:76924) |
| (+)-tephrorin B (CHEBI:66200) is a cinnamate ester (CHEBI:36087) |
| (+)-tephrorin B (CHEBI:66200) is a monohydroxyflavanone (CHEBI:38748) |
| (+)-tephrorin B (CHEBI:66200) is a oxolanes (CHEBI:26912) |
| Synonym | Source |
|---|---|
| (3S,4S)-4-[(2S)-3,4-dihydro-7-hydroxy-4-oxo-2-phenyl-2H-1-benzopyran-8-yl]tetrahydro-2,2-dimethyl-3-furanyl(2E)-3-phenyl-2-propenoate | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12140009 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8656625 | Reaxys |
| Citations |
|---|