EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H26O7 |
| Net Charge | 0 |
| Average Mass | 426.465 |
| Monoisotopic Mass | 426.16785 |
| SMILES | COc1ccc2c(c1[C@H]1[C@@H](O)OC(C)(C)[C@H]1OC(C)=O)O[C@H](c1ccccc1)CC2=O |
| InChI | InChI=1S/C24H26O7/c1-13(25)29-22-20(23(27)31-24(22,2)3)19-17(28-4)11-10-15-16(26)12-18(30-21(15)19)14-8-6-5-7-9-14/h5-11,18,20,22-23,27H,12H2,1-4H3/t18-,20+,22-,23-/m0/s1 |
| InChIKey | GSLOHPSPTJDYHS-NKRSRWBGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tephrosia purpurea (ncbitaxon:228354) | - | PubMed (10814365) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (+)-tephrorin A (CHEBI:66199) has role antineoplastic agent (CHEBI:35610) |
| (+)-tephrorin A (CHEBI:66199) has role plant metabolite (CHEBI:76924) |
| (+)-tephrorin A (CHEBI:66199) is a acetate ester (CHEBI:47622) |
| (+)-tephrorin A (CHEBI:66199) is a monomethoxyflavanone (CHEBI:38738) |
| (+)-tephrorin A (CHEBI:66199) is a oxolanes (CHEBI:26912) |
| (+)-tephrorin A (CHEBI:66199) is a secondary alcohol (CHEBI:35681) |
| Synonym | Source |
|---|---|
| (2S)-8-[(2S,3R,4S)-4-(acetyloxy)tetrahydro-2-hydroxy-5,5-dimethyl-3-furanyl]-2,3-dihydro-7-methoxy-2-phenyl-4H-1-benzopyran-4-one | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| LMPK12140008 | LIPID MAPS |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8650234 | Reaxys |
| Citations |
|---|