EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H44O8 |
| Net Charge | 0 |
| Average Mass | 520.663 |
| Monoisotopic Mass | 520.30362 |
| SMILES | [H][C@]12[C@@H](OC(=O)[C@H](C)[C@H](C)O)CC(C)=C([C@@H](OC(C)=O)C[C@]3(C)CC[C@H](O)C(=C)[C@@]3([H])[C@@H]1OC(C)=O)C2(C)C |
| InChI | InChI=1S/C29H44O8/c1-14-12-21(37-27(34)15(2)17(4)30)25-26(36-19(6)32)24-16(3)20(33)10-11-29(24,9)13-22(35-18(5)31)23(14)28(25,7)8/h15,17,20-22,24-26,30,33H,3,10-13H2,1-2,4-9H3/t15-,17+,20+,21+,22+,24+,25+,26+,29+/m1/s1 |
| InChIKey | NYZTVYMLRZLUBV-UOIGVGIGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taxus sumatrana (ncbitaxon:450883) | |||
| twig (BTO:0001411) | DOI (10.1016/j.tet.2004.10.110) | ||
| leaf (BTO:0000713) | DOI (10.1016/j.tet.2004.10.110) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tasumatrol K (CHEBI:66198) has role metabolite (CHEBI:25212) |
| Tasumatrol K (CHEBI:66198) is a taxane diterpenoid (CHEBI:50367) |