EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H34O9 |
| Net Charge | 0 |
| Average Mass | 526.582 |
| Monoisotopic Mass | 526.22028 |
| SMILES | [H][C@]12[C@H](OC(=O)c3ccccc3)[C@]34CCC(C)=C3[C@@](O)(C(=O)OC4(C)C)[C@]1(C)[C@@H](O)C[C@@]1([H])OC[C@@]21OC(C)=O |
| InChI | InChI=1S/C29H34O9/c1-15-11-12-27-20(15)29(34,24(33)38-25(27,3)4)26(5)18(31)13-19-28(14-35-19,37-16(2)30)21(26)22(27)36-23(32)17-9-7-6-8-10-17/h6-10,18-19,21-22,31,34H,11-14H2,1-5H3/t18-,19+,21-,22-,26+,27-,28-,29+/m0/s1 |
| InChIKey | SVGLRYYOFWEEMV-KKRTVMRJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taxus sumatrana (ncbitaxon:450883) | |||
| leaf (BTO:0000713) | DOI (10.1016/j.tet.2004.10.110) | ||
| twig (BTO:0001411) | DOI (10.1016/j.tet.2004.10.110) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Tasumatrol J(rel) (CHEBI:66197) has role metabolite (CHEBI:25212) |
| Tasumatrol J(rel) (CHEBI:66197) is a benzoate ester (CHEBI:36054) |