EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H44O12 |
| Net Charge | 0 |
| Average Mass | 632.703 |
| Monoisotopic Mass | 632.28328 |
| SMILES | [H][C@@]12[C@H](COC(C)=O)[C@@H](OC(C)=O)C[C@H](OC(C)=O)[C@@]1(C)[C@@H](OC(=O)c1ccccc1)[C@H](O)C1=C(C)[C@@H](O)C[C@@]1(C(C)(C)O)[C@H]2O |
| InChI | InChI=1S/C33H44O12/c1-16-22(37)14-33(31(5,6)41)25(16)27(38)29(45-30(40)20-11-9-8-10-12-20)32(7)24(44-19(4)36)13-23(43-18(3)35)21(15-42-17(2)34)26(32)28(33)39/h8-12,21-24,26-29,37-39,41H,13-15H2,1-7H3/t21-,22+,23+,24+,26+,27-,28+,29+,32-,33+/m1/s1 |
| InChIKey | WYKZKHDIJKKRNQ-VEHPFIPQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taxus sumatrana (ncbitaxon:450883) | |||
| leaf (BTO:0000713) | PubMed (15679325) | ||
| twig (BTO:0001411) | PubMed (15679325) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tasumatrol F (CHEBI:66195) has role antineoplastic agent (CHEBI:35610) |
| tasumatrol F (CHEBI:66195) has role metabolite (CHEBI:25212) |
| tasumatrol F (CHEBI:66195) is a acetate ester (CHEBI:47622) |
| tasumatrol F (CHEBI:66195) is a benzoate ester (CHEBI:36054) |
| tasumatrol F (CHEBI:66195) is a secondary alcohol (CHEBI:35681) |
| tasumatrol F (CHEBI:66195) is a taxane diterpenoid (CHEBI:50367) |
| tasumatrol F (CHEBI:66195) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2S,3aS,4S,4aR,5R,6S,8S,8aS,9R,10R)-6,8-bis(acetyloxy)-5-[(acetyloxy)methyl]-2,4,10-trihydroxy-3a-(2-hydroxypropan-2-yl)-1,8a-dimethyl-2,3,3a,4,4a,5,6,7,8,8a,9,10-dodecahydrobenzo[f]azulen-9-yl benzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10228313 | Reaxys |
| Citations |
|---|