EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H44O13 |
| Net Charge | 0 |
| Average Mass | 648.702 |
| Monoisotopic Mass | 648.27819 |
| SMILES | [H][C@]12[C@H](O)[C@]3(C(C)(C)O)C[C@H](O)C(C)=C3[C@@H](O)[C@H](OC(=O)c3ccccc3)[C@]1(C)[C@@H](OC(C)=O)C[C@H](OC(C)=O)[C@@]2(O)COC(C)=O |
| InChI | InChI=1S/C33H44O13/c1-16-21(37)14-32(30(5,6)41)24(16)25(38)28(46-29(40)20-11-9-8-10-12-20)31(7)22(44-18(3)35)13-23(45-19(4)36)33(42,15-43-17(2)34)26(31)27(32)39/h8-12,21-23,25-28,37-39,41-42H,13-15H2,1-7H3/t21-,22-,23-,25+,26-,27-,28-,31+,32-,33-/m0/s1 |
| InChIKey | LERGIFKZIYQODU-KNIUGVHDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Taxus sumatrana (ncbitaxon:450883) | |||
| twig (BTO:0001411) | PubMed (15679325) | ||
| leaf (BTO:0000713) | PubMed (15679325) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tasumatrol E (CHEBI:66194) has role antineoplastic agent (CHEBI:35610) |
| tasumatrol E (CHEBI:66194) has role metabolite (CHEBI:25212) |
| tasumatrol E (CHEBI:66194) is a acetate ester (CHEBI:47622) |
| tasumatrol E (CHEBI:66194) is a benzoate ester (CHEBI:36054) |
| tasumatrol E (CHEBI:66194) is a carbotricyclic compound (CHEBI:38032) |
| tasumatrol E (CHEBI:66194) is a secondary alcohol (CHEBI:35681) |
| tasumatrol E (CHEBI:66194) is a taxane diterpenoid (CHEBI:50367) |
| tasumatrol E (CHEBI:66194) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2S,3aS,4S,4aR,5S,6S,8S,8aS,9R,10R)-6,8-bis(acetyloxy)-5-[(acetyloxy)methyl]-2,4,5,10-tetrahydroxy-3a-(2-hydroxypropan-2-yl)-1,8a-dimethyl-2,3,3a,4,4a,5,6,7,8,8a,9,10-dodecahydrobenzo[f]azulen-9-yl benzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10229612 | Reaxys |
| Citations |
|---|