EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H44O9 |
| Net Charge | 0 |
| Average Mass | 548.673 |
| Monoisotopic Mass | 548.29853 |
| SMILES | [H][C@@]12C[C@@H](O[C@@H]3O[C@@H](C)[C@H](O)[C@@H](OC)[C@@H]3O)CC[C@]1(C)[C@@]1([H])CC[C@]3(C)[C@@H](C4=CC(=O)OC4)CC[C@]3(O)[C@@]13O[C@H]3C2 |
| InChI | InChI=1S/C30H44O9/c1-15-23(32)25(35-4)24(33)26(37-15)38-18-5-8-27(2)17(12-18)13-21-30(39-21)20(27)7-9-28(3)19(6-10-29(28,30)34)16-11-22(31)36-14-16/h11,15,17-21,23-26,32-34H,5-10,12-14H2,1-4H3/t15-,17-,18-,19+,20+,21-,23-,24-,25+,26-,27-,28+,29+,30+/m0/s1 |
| InChIKey | LVGNJQMAMYJAIL-FWMNQDIBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cerbera manghas (ncbitaxon:141545) | |||
| seed (BTO:0001226) | DOI (10.1248/cpb.25.2744) | ||
| bark (BTO:0001301) | DOI (10.1248/cpb.25.2744) | ||
| leaf (BTO:0000713) | DOI (10.1248/cpb.25.2744) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deacetyltanghinin (CHEBI:66193) has functional parent tanghinigenin (CHEBI:74633) |
| deacetyltanghinin (CHEBI:66193) has role antineoplastic agent (CHEBI:35610) |
| deacetyltanghinin (CHEBI:66193) has role metabolite (CHEBI:25212) |
| deacetyltanghinin (CHEBI:66193) is a cardenolide glycoside (CHEBI:38092) |
| deacetyltanghinin (CHEBI:66193) is a epoxy steroid (CHEBI:145217) |
| deacetyltanghinin (CHEBI:66193) is a monosaccharide derivative (CHEBI:63367) |
| deacetyltanghinin (CHEBI:66193) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (3β,5β,7β)-3-[(6-deoxy-3-O-methyl-α-L-glucopyranosyl)oxy]-14-hydroxy-7,8-epoxycard-20(22)-enolide |
| Synonym | Source |
|---|---|
| (3β-O-α-L-thevetosyl)-14β-hydroxy-7,8-epoxy-5β-card-20(22)-enolide | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1337482 | Reaxys |
| CAS:4589-95-1 | ChemIDplus |
| Citations |
|---|