EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H46O10 |
| Net Charge | 0 |
| Average Mass | 590.710 |
| Monoisotopic Mass | 590.30910 |
| SMILES | [H][C@@]1(O[C@H]2CC[C@@]3(C)[C@@]([H])(C2)C[C@@H]2O[C@]24[C@]3([H])CC[C@]2(C)[C@@H](C3=CC(=O)OC3)CC[C@]42O)O[C@@H](C)[C@H](O)[C@@H](OC)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C32H46O10/c1-16-25(35)26(37-5)27(40-17(2)33)28(39-16)41-20-6-9-29(3)19(13-20)14-23-32(42-23)22(29)8-10-30(4)21(7-11-31(30,32)36)18-12-24(34)38-15-18/h12,16,19-23,25-28,35-36H,6-11,13-15H2,1-5H3/t16-,19-,20-,21+,22+,23-,25-,26+,27-,28-,29-,30+,31+,32+/m0/s1 |
| InChIKey | BTRWTSHCXGFFFL-NNYOWCKQSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cerbera manghas (ncbitaxon:141545) | |||
| leaf (BTO:0000713) | DOI (10.1248/cpb.25.2744) | ||
| seed (BTO:0001226) | DOI (10.1248/cpb.25.2744) | ||
| bark (BTO:0001301) | DOI (10.1248/cpb.25.2744) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. cardioprotective agent Any protective agent that is able to prevent damage to the heart. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tanghinin (CHEBI:66192) has functional parent tanghinigenin (CHEBI:74633) |
| tanghinin (CHEBI:66192) has role antineoplastic agent (CHEBI:35610) |
| tanghinin (CHEBI:66192) has role metabolite (CHEBI:25212) |
| tanghinin (CHEBI:66192) is a acetate ester (CHEBI:47622) |
| tanghinin (CHEBI:66192) is a cardenolide glycoside (CHEBI:38092) |
| tanghinin (CHEBI:66192) is a epoxide (CHEBI:32955) |
| tanghinin (CHEBI:66192) is a monosaccharide derivative (CHEBI:63367) |
| tanghinin (CHEBI:66192) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| 3β-[(2-O-acetyl-6-deoxy-3-O-methyl-α-L-glucopyranosyl)oxy]-14-hydroxy-5β,7β-7,8-epoxycard-20(22)-enolide |
| Synonyms | Source |
|---|---|
| 3-((2-O-acetyl-6-deoxy-3-O-methyl-α-L-glucopranosyl)oxy)tanghinigenin | ChEBI |
| 3-β-O-(2'-O-acetyl-α-L-thevetosyl)-14β-hydroxy-7,8-epoxy-5β-card-20(22)-enolide | ChEBI |
| (3β,5β,7β)-3-[(2-O-acetyl-6-deoxy-3-O-methyl-α-L-glucopyranosyl)oxy]-14-hydroxy-7,8-epoxycard-20(22)-enolide | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| 16736053 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9890412 | Reaxys |
| CAS:25390-16-3 | ChemIDplus |
| Citations |
|---|