EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H28O7 |
| Net Charge | 0 |
| Average Mass | 440.492 |
| Monoisotopic Mass | 440.18350 |
| SMILES | C=C(C)C(O)CC/C(C)=C/Cc1c(O)cc2c(c1O)C(=O)C[C@@H](c1ccc(O)c(O)c1)O2 |
| InChI | InChI=1S/C25H28O7/c1-13(2)17(26)8-5-14(3)4-7-16-19(28)11-23-24(25(16)31)21(30)12-22(32-23)15-6-9-18(27)20(29)10-15/h4,6,9-11,17,22,26-29,31H,1,5,7-8,12H2,2-3H3/b14-4+/t17?,22-/m0/s1 |
| InChIKey | VALTWXVTFHGVHS-ILVSVAAVSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga tanarius (ncbitaxon:109849) | leaf (BTO:0000713) | PubMed (15974621) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tanariflavanone D (CHEBI:66191) has role antineoplastic agent (CHEBI:35610) |
| tanariflavanone D (CHEBI:66191) has role metabolite (CHEBI:25212) |
| tanariflavanone D (CHEBI:66191) has role radical scavenger (CHEBI:48578) |
| tanariflavanone D (CHEBI:66191) is a 4'-hydroxyflavanones (CHEBI:140331) |
| tanariflavanone D (CHEBI:66191) is a secondary alcohol (CHEBI:35681) |
| tanariflavanone D (CHEBI:66191) is a tetrahydroxyflavanone (CHEBI:38742) |
| IUPAC Name |
|---|
| (2S)-2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-6-[(2E)-6-hydroxy-3,7-dimethylocta-2,7-dien-1-yl]-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| (2S)-5,7,3',4'-tetrahydroxy-6-(6-hydroxy-3,7-dimethylocta-2',7'-dienyl)-flavanone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15840356 | Reaxys |
| Citations |
|---|