EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:66190 - tanariflavanone C
| Formula | C30H36O7 |
| Net Charge | 0 |
| Average Mass | 508.611 |
| Monoisotopic Mass | 508.24610 |
| SMILES | C=C(C)C(O)Cc1c(O)cc2c(c1O)C(=O)C[C@@H](c1ccc(O)c(O)c1C/C=C(\C)CCC=C(C)C)O2 |
| InChI | InChI=1S/C30H36O7/c1-16(2)7-6-8-18(5)9-10-20-19(11-12-22(31)29(20)35)26-15-25(34)28-27(37-26)14-24(33)21(30(28)36)13-23(32)17(3)4/h7,9,11-12,14,23,26,31-33,35-36H,3,6,8,10,13,15H2,1-2,4-5H3/b18-9+/t23?,26-/m0/s1 |
| InChIKey | YMILJRPIVTZKTL-OCFJWBBSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga tanarius (ncbitaxon:109849) | leaf (BTO:0000713) | PubMed (15974621) |
| Roles Classification |
|---|
| Chemical Role: | radical scavenger A role played by a substance that can react readily with, and thereby eliminate, radicals. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tanariflavanone C (CHEBI:66190) has role metabolite (CHEBI:25212) |
| tanariflavanone C (CHEBI:66190) has role radical scavenger (CHEBI:48578) |
| tanariflavanone C (CHEBI:66190) is a 4'-hydroxyflavanones (CHEBI:140331) |
| tanariflavanone C (CHEBI:66190) is a secondary alcohol (CHEBI:35681) |
| tanariflavanone C (CHEBI:66190) is a tetrahydroxyflavanone (CHEBI:38742) |
| IUPAC Name |
|---|
| (2S)-2-{2-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-3,4-dihydroxyphenyl}-5,7-dihydroxy-6-(2-hydroxy-3-methylbut-3-en-1-yl)-2,3-dihydro-4H-chromen-4-one |
| Synonym | Source |
|---|---|
| (2S)-5,7,3',4'-tetrahydroxy-6-(2-hydroxy-3-methylbut-3-enyl)-2'-(geranyl)flavanone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15840359 | Reaxys |
| Citations |
|---|