EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H34O6 |
| Net Charge | 0 |
| Average Mass | 490.596 |
| Monoisotopic Mass | 490.23554 |
| SMILES | CC(C)=CCCC1(C)C=Cc2c([C@@H]3CC(=O)c4c(cc(O)c(CC=C(C)C)c4O)O3)ccc(O)c2O1 |
| InChI | InChI=1S/C30H34O6/c1-17(2)7-6-13-30(5)14-12-20-19(10-11-22(31)29(20)36-30)25-16-24(33)27-26(35-25)15-23(32)21(28(27)34)9-8-18(3)4/h7-8,10-12,14-15,25,31-32,34H,6,9,13,16H2,1-5H3/t25-,30?/m0/s1 |
| InChIKey | URMUEILYNQBSDZ-SUHMBNCMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga tanarius (ncbitaxon:109849) | leaf (BTO:0000713) | PubMed (11421757) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tanariflavanone B (CHEBI:66189) has role allelochemical (CHEBI:62215) |
| tanariflavanone B (CHEBI:66189) has role plant metabolite (CHEBI:76924) |
| tanariflavanone B (CHEBI:66189) is a 4'-hydroxyflavanones (CHEBI:140331) |
| tanariflavanone B (CHEBI:66189) is a trihydroxyflavanone (CHEBI:38739) |
| IUPAC Name |
|---|
| (2S)-5,7,8'-trihydroxy-2'-methyl-6-(3-methylbut-2-en-1-yl)-2'-(4-methylpent-3-en-1-yl)-2,3-dihydro-2'H,4H-2,5'-bichromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8882587 | Reaxys |
| Citations |
|---|