EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36O7 |
| Net Charge | 0 |
| Average Mass | 508.611 |
| Monoisotopic Mass | 508.24610 |
| SMILES | CC(C)=CCC/C(C)=C/Cc1c([C@@H]2CC(=O)c3c(cc4c(c3O)CC(O)C(C)(C)O4)O2)ccc(O)c1O |
| InChI | InChI=1S/C30H36O7/c1-16(2)7-6-8-17(3)9-10-19-18(11-12-21(31)28(19)34)23-14-22(32)27-25(36-23)15-24-20(29(27)35)13-26(33)30(4,5)37-24/h7,9,11-12,15,23,26,31,33-35H,6,8,10,13-14H2,1-5H3/b17-9+/t23-,26?/m0/s1 |
| InChIKey | BTDKFPKJPIGYFD-NBNDFHJKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Macaranga tanarius (ncbitaxon:109849) | leaf (BTO:0000713) | PubMed (11421757) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tanariflavanone A (CHEBI:66188) has role allelochemical (CHEBI:62215) |
| tanariflavanone A (CHEBI:66188) has role plant metabolite (CHEBI:76924) |
| tanariflavanone A (CHEBI:66188) is a extended flavonoid (CHEBI:71037) |
| tanariflavanone A (CHEBI:66188) is a hydroxyflavanone (CHEBI:24697) |
| tanariflavanone A (CHEBI:66188) is a pyranochromane (CHEBI:74632) |
| IUPAC Name |
|---|
| (8S)-8-{2-[(2E)-3,7-dimethylocta-2,6-dien-1-yl]-3,4-dihydroxyphenyl}-3,5-dihydroxy-2,2-dimethyl-3,4,7,8-tetrahydro-2H,6H-pyrano[3,2-]chromen-6-one |
| Synonym | Source |
|---|---|
| (2S)-2'-geranyl-5,3',4'-trihydroxy-6,7-(2,2-dimethyl-3-hydroxychromano)flavanone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8885265 | Reaxys |
| Citations |
|---|