EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34O10 |
| Net Charge | 0 |
| Average Mass | 530.570 |
| Monoisotopic Mass | 530.21520 |
| SMILES | CCCCCC(=O)OC1c2cc3c(c4c2C(C(=O)C(=O)OC)(CO4)/C(=C\C(=O)OC)CC(C)C1C)OCO3 |
| InChI | InChI=1S/C28H34O10/c1-6-7-8-9-20(29)38-23-16(3)15(2)10-17(11-21(30)33-4)28(26(31)27(32)34-5)13-35-25-22(28)18(23)12-19-24(25)37-14-36-19/h11-12,15-16,23H,6-10,13-14H2,1-5H3/b17-11- |
| InChIKey | CAOGJIYLLPIVFO-BOPFTXTBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura matsudai (IPNI:554587-1) | stem (BTO:0001300) | PubMed (11215493) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taiwanschirin D (CHEBI:66185) has role plant metabolite (CHEBI:76924) |
| taiwanschirin D (CHEBI:66185) is a cyclic ether (CHEBI:37407) |
| taiwanschirin D (CHEBI:66185) is a enoate ester (CHEBI:51702) |
| taiwanschirin D (CHEBI:66185) is a hexanoate ester (CHEBI:87656) |
| taiwanschirin D (CHEBI:66185) is a methyl ester (CHEBI:25248) |
| taiwanschirin D (CHEBI:66185) is a organic heterotetracyclic compound (CHEBI:38163) |
| taiwanschirin D (CHEBI:66185) is a α-ketoester (CHEBI:51848) |
| IUPAC Name |
|---|
| (3Z)-2a-[methoxy(oxo)acetyl]-3-(2-methoxy-2-oxoethylidene)-5,6-dimethyl-2a,3,4,5,6,7-hexahydro-2H-1,9,11-trioxacycloocta[cd]-as-indacen-7-yl hexanoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8811894 | Reaxys |
| Citations |
|---|