EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H30O13 |
| Net Charge | 0 |
| Average Mass | 610.568 |
| Monoisotopic Mass | 610.16864 |
| SMILES | COC(=O)/C=C1/[C@H](OC(=O)c2ccccc2)[C@@]2(C)O[C@](O)(C(=O)OC)[C@@]13COc1c4c(cc(c13)[C@H](OC(C)=O)[C@@H]2C)OCO4 |
| InChI | InChI=1S/C31H30O13/c1-15-23(42-16(2)32)18-11-20-24(41-14-40-20)25-22(18)30(13-39-25)19(12-21(33)37-4)26(43-27(34)17-9-7-6-8-10-17)29(15,3)44-31(30,36)28(35)38-5/h6-12,15,23,26,36H,13-14H2,1-5H3/b19-12-/t15-,23+,26-,29-,30-,31+/m0/s1 |
| InChIKey | NDPAAFXCQBLVTE-FBRIBSNSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura philippinensis (IPNI:554591-1) | aerial part (BTO:0001658) | PubMed (16268562) |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taiwankadsurin B (CHEBI:66184) has role plant metabolite (CHEBI:76924) |
| taiwankadsurin B (CHEBI:66184) is a acetate ester (CHEBI:47622) |
| taiwankadsurin B (CHEBI:66184) is a benzoate ester (CHEBI:36054) |
| taiwankadsurin B (CHEBI:66184) is a methyl ester (CHEBI:25248) |
| taiwankadsurin B (CHEBI:66184) is a organic heteropentacyclic compound (CHEBI:38164) |
| taiwankadsurin B (CHEBI:66184) is a oxacycle (CHEBI:38104) |
| IUPAC Name |
|---|
| methyl (2aS,3E,4S,5S,6S,7R,13S)-7-(acetyloxy)-4-(benzoyloxy)-13-hydroxy-3-(2-methoxy-2-oxoethylidene)-5,6-dimethyl-4,5,6,7-tetrahydro-3H-5,2a-(epoxymethano)-1,9,11-trioxacycloocta[cd]-as-indacene-13(2H)-carboxylate |
| Citations |
|---|