EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H24O10 |
| Net Charge | 0 |
| Average Mass | 568.534 |
| Monoisotopic Mass | 568.13695 |
| SMILES | COc1cc2c(c(O)c1Oc1ccc(-c3cc(=O)c4c(O)c(C)c(O)cc4o3)cc1)C(=O)CC(c1ccc(O)cc1)O2 |
| InChI | InChI=1S/C32H24O10/c1-15-20(34)11-25-28(30(15)37)21(35)12-24(41-25)17-5-9-19(10-6-17)40-32-27(39-2)14-26-29(31(32)38)22(36)13-23(42-26)16-3-7-18(33)8-4-16/h3-12,14,23,33-34,37-38H,13H2,1-2H3 |
| InChIKey | QNXAIIZZUIKOEY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cephalotaxus wilsoniana (ncbitaxon:50179) | |||
| stem (BTO:0001300) | PubMed (12499600) | ||
| twig (BTO:0001411) | PubMed (12499600) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taiwanhomoflavone-B (CHEBI:66183) has role antineoplastic agent (CHEBI:35610) |
| taiwanhomoflavone-B (CHEBI:66183) has role metabolite (CHEBI:25212) |
| taiwanhomoflavone-B (CHEBI:66183) is a biflavonoid (CHEBI:50128) |
| taiwanhomoflavone-B (CHEBI:66183) is a hydroxyflavone (CHEBI:24698) |
| taiwanhomoflavone-B (CHEBI:66183) is a methoxyflavone (CHEBI:25241) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-{[5-hydroxy-2-(4-hydroxyphenyl)-7-methoxy-4-oxo-3,4-dihydro-2H-chromen-6-yl]oxy}phenyl)-6-methyl-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9309381 | Reaxys |
| Citations |
|---|