EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H24O10 |
| Net Charge | 0 |
| Average Mass | 580.545 |
| Monoisotopic Mass | 580.13695 |
| SMILES | COc1ccc(-c2cc(=O)c3c(O)c(C)c(OC)cc3o2)cc1-c1c(O)cc(O)c2c(=O)cc(-c3ccc(O)cc3)oc12 |
| InChI | InChI=1S/C33H24O10/c1-15-25(41-3)14-28-31(32(15)39)23(38)13-27(42-28)17-6-9-24(40-2)19(10-17)29-20(35)11-21(36)30-22(37)12-26(43-33(29)30)16-4-7-18(34)8-5-16/h4-14,34-36,39H,1-3H3 |
| InChIKey | BZHVWUXJPKVWAI-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cephalotaxus wilsoniana (ncbitaxon:50179) | |||
| twig (BTO:0001411) | PubMed (10726874) | ||
| stem (BTO:0001300) | PubMed (10726874) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| taiwanhomoflavone A (CHEBI:66182) has role antineoplastic agent (CHEBI:35610) |
| taiwanhomoflavone A (CHEBI:66182) has role metabolite (CHEBI:25212) |
| taiwanhomoflavone A (CHEBI:66182) is a biaryl (CHEBI:64459) |
| taiwanhomoflavone A (CHEBI:66182) is a biflavonoid (CHEBI:50128) |
| taiwanhomoflavone A (CHEBI:66182) is a hydroxyflavone (CHEBI:24698) |
| taiwanhomoflavone A (CHEBI:66182) is a methoxyflavone (CHEBI:25241) |
| IUPAC Name |
|---|
| 2-{3-[5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-8-yl]-4-methoxyphenyl}-5-hydroxy-7-methoxy-6-methyl-4H-chromen-4-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8666542 | Reaxys |
| Citations |
|---|