EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O4 |
| Net Charge | 0 |
| Average Mass | 252.310 |
| Monoisotopic Mass | 252.13616 |
| SMILES | [H][C@@]12CCCC[C@H](C)OC(=O)C[C@@]1([H])[C@@H](O)C=CC2=O |
| InChI | InChI=1S/C14H20O4/c1-9-4-2-3-5-10-11(8-14(17)18-9)13(16)7-6-12(10)15/h6-7,9-11,13,16H,2-5,8H2,1H3/t9-,10+,11+,13-/m0/s1 |
| InChIKey | WTQWDNIIFGEBSZ-WGBDABJCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium verrucosum (ncbitaxon:60171) | - | PubMed (14695789) |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. EC 2.7.7.6 (RNA polymerase) inhibitor An EC 2.7.7.* (nucleotidyltransferase) inhibitor that interferes with the action of RNA polymerase (EC 2.7.7.6). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sch 642305 (CHEBI:66181) has role Penicillium metabolite (CHEBI:76964) |
| sch 642305 (CHEBI:66181) has role EC 2.7.7.6 (RNA polymerase) inhibitor (CHEBI:37416) |
| sch 642305 (CHEBI:66181) is a enone (CHEBI:51689) |
| sch 642305 (CHEBI:66181) is a macrocyclic lactone (CHEBI:63944) |
| IUPAC Name |
|---|
| (4S,8aR,12S,12aR)-12-hydroxy-4-methyl-4,5,6,7,8,8a,12,12a-octahydro-2H-3-benzoxecine-2,9(1H)-dione |
| Synonym | Source |
|---|---|
| (+)-sch 642305 | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9780683 | Reaxys |
| Citations |
|---|