EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H29ClN2O9 |
| Net Charge | 0 |
| Average Mass | 597.020 |
| Monoisotopic Mass | 596.15616 |
| SMILES | [H][C@@]12Cc3c(c(O)c4c(=O)n(N)c(C(C)CC)cc4c3Cl)-c3c(O)c4c(c(c31)OCO2)O[C@]1([H])[C@H](OC)C=C[C@H](O)[C@]1([H])C4=O |
| InChI | InChI=1S/C30H29ClN2O9/c1-4-10(2)13-7-11-18(30(38)33(13)32)24(35)17-12(23(11)31)8-16-20-21(17)26(37)22-25(36)19-14(34)5-6-15(39-3)27(19)42-29(22)28(20)41-9-40-16/h5-7,10,14-16,19,27,34-35,37H,4,8-9,32H2,1-3H3/t10?,14-,15+,16+,19+,27+/m0/s1 |
| InChIKey | LGOPVBMUGSRUOT-NLGWJYKOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Actinoplanes (ncbitaxon:1871) | |||
| - | PubMed (9170295) | Strain: SCC 2314 | |
| - | PubMed (9170295) | Strain: ATCC 55600 |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sch 54445 (CHEBI:66180) has role antifungal agent (CHEBI:35718) |
| sch 54445 (CHEBI:66180) has role metabolite (CHEBI:25212) |
| sch 54445 (CHEBI:66180) is a cyclic acetal (CHEBI:59770) |
| sch 54445 (CHEBI:66180) is a ether (CHEBI:25698) |
| sch 54445 (CHEBI:66180) is a hydrazines (CHEBI:24631) |
| sch 54445 (CHEBI:66180) is a lactam (CHEBI:24995) |
| sch 54445 (CHEBI:66180) is a organic heteroheptacyclic compound (CHEBI:52157) |
| sch 54445 (CHEBI:66180) is a organochlorine compound (CHEBI:36683) |
| sch 54445 (CHEBI:66180) is a phenols (CHEBI:33853) |
| sch 54445 (CHEBI:66180) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (1S,4R,4aS,8aR,17aS)-13-amino-12-(butan-2-yl)-10-chloro-1,15,16-trihydroxy-4-methoxy-4a,8a,13,17a-tetrahydro-1H-chromeno[2',3':6,7][1,3]dioxino[4',5',6':4,5]naphtho[2,1-g]isoquinoline-14,17(4H,9H)-dione |
| Citations |
|---|