EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H24O3 |
| Net Charge | 0 |
| Average Mass | 252.354 |
| Monoisotopic Mass | 252.17254 |
| SMILES | [H][C@@]12CC(C)(C)[C@@]1([H])CC/C(C)=C\C(=O)[C@@H](O)[C@H]2CO |
| InChI | InChI=1S/C15H24O3/c1-9-4-5-12-10(7-15(12,2)3)11(8-16)14(18)13(17)6-9/h6,10-12,14,16,18H,4-5,7-8H2,1-3H3/b9-6-/t10-,11-,12-,14-/m0/s1 |
| InChIKey | RCNNSAWFPVOGAA-QCDYRJBNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Chrysosporium pilosum (ncbitaxon:108923) | - | PubMed (19183048) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sch 725432 (CHEBI:66179) has role antifungal agent (CHEBI:35718) |
| sch 725432 (CHEBI:66179) has role metabolite (CHEBI:25212) |
| sch 725432 (CHEBI:66179) is a carbobicyclic compound (CHEBI:36785) |
| sch 725432 (CHEBI:66179) is a enone (CHEBI:51689) |
| sch 725432 (CHEBI:66179) is a primary alcohol (CHEBI:15734) |
| sch 725432 (CHEBI:66179) is a secondary alcohol (CHEBI:35681) |
| sch 725432 (CHEBI:66179) is a secondary α-hydroxy ketone (CHEBI:2468) |
| sch 725432 (CHEBI:66179) is a sesquiterpenoid (CHEBI:26658) |
| IUPAC Name |
|---|
| (1R,2R,3S,5Z,9S)-3-hydroxy-2-(hydroxymethyl)-6,10,10-trimethylbicyclo[7.2.0]undec-5-en-4-one |
| Citations |
|---|