EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H27NO3 |
| Net Charge | 0 |
| Average Mass | 281.396 |
| Monoisotopic Mass | 281.19909 |
| SMILES | C/C=C/CCCCC(=O)C(C)C(=O)N1CCC[C@@H]1CO |
| InChI | InChI=1S/C16H27NO3/c1-3-4-5-6-7-10-15(19)13(2)16(20)17-11-8-9-14(17)12-18/h3-4,13-14,18H,5-12H2,1-2H3/b4-3+/t13?,14-/m1/s1 |
| InChIKey | LCDBRGPJMWXDGF-RTEOAJGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Penicillium citrinum (ncbitaxon:5077) | - | PubMed (15730261) | Strain: N055 |
| Roles Classification |
|---|
| Biological Roles: | Penicillium metabolite Any fungal metabolite produced during a metabolic reaction in Penicillium. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| scalusamide A (CHEBI:66177) has role Penicillium metabolite (CHEBI:76964) |
| scalusamide A (CHEBI:66177) has role antibacterial agent (CHEBI:33282) |
| scalusamide A (CHEBI:66177) has role antifungal agent (CHEBI:35718) |
| scalusamide A (CHEBI:66177) is a monocarboxylic acid amide (CHEBI:29347) |
| scalusamide A (CHEBI:66177) is a primary alcohol (CHEBI:15734) |
| scalusamide A (CHEBI:66177) is a pyrrolidine alkaloid (CHEBI:26456) |
| IUPAC Name |
|---|
| (8E)-1-[(2R)-2-(hydroxymethyl)pyrrolidin-1-yl]-2-methyldec-8-ene-1,3-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15768979 | Reaxys |
| Citations |
|---|