EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H50O4 |
| Net Charge | 0 |
| Average Mass | 462.715 |
| Monoisotopic Mass | 462.37091 |
| SMILES | [H][C@@]12C[C@@H](O)[C@@]3(O)C[C@@H](O)CC[C@]3(C)[C@@]1([H])CC[C@]1(C)C([C@@](C)(O)CC(C)C(C)C(C)C)=CC[C@@]21[H] |
| InChI | InChI=1S/C29H50O4/c1-17(2)19(4)18(3)15-28(7,32)24-9-8-22-21-14-25(31)29(33)16-20(30)10-13-27(29,6)23(21)11-12-26(22,24)5/h9,17-23,25,30-33H,8,10-16H2,1-7H3/t18?,19?,20-,21-,22-,23-,25+,26-,27+,28-,29-/m0/s1 |
| InChIKey | FSVRNTKWAJDYID-RVFKALSBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sarcophyton trocheliophorum (ncbitaxon:205097) | - | PubMed (10923847) |
| Roles Classification |
|---|
| Biological Role: | coral metabolite Any animal metabolite produced during a metabolic reaction in corals (marine invertebrates). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 23,24-dimethylcholest-16(17)-E-en-3β,5α,6β,20(S)-tetrol (CHEBI:66175) has role antineoplastic agent (CHEBI:35610) |
| 23,24-dimethylcholest-16(17)-E-en-3β,5α,6β,20(S)-tetrol (CHEBI:66175) has role coral metabolite (CHEBI:76498) |
| 23,24-dimethylcholest-16(17)-E-en-3β,5α,6β,20(S)-tetrol (CHEBI:66175) is a 20-hydroxy steroid (CHEBI:36854) |
| 23,24-dimethylcholest-16(17)-E-en-3β,5α,6β,20(S)-tetrol (CHEBI:66175) is a 3β-hydroxy steroid (CHEBI:36836) |
| 23,24-dimethylcholest-16(17)-E-en-3β,5α,6β,20(S)-tetrol (CHEBI:66175) is a 5α-hydroxy steroid (CHEBI:38194) |
| 23,24-dimethylcholest-16(17)-E-en-3β,5α,6β,20(S)-tetrol (CHEBI:66175) is a 6β-hydroxy steroid (CHEBI:36851) |
| IUPAC Name |
|---|
| (3β,5α,6β,24ξ)-23-methylergost-16-ene-3,5,6,20-tetrol |
| Synonym | Source |
|---|---|
| Sarcophyton polyhydroxysterol | ChEBI |
| Citations |
|---|