EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H38N2O13 |
| Net Charge | 0 |
| Average Mass | 694.690 |
| Monoisotopic Mass | 694.23739 |
| SMILES | CC[C@H](C)C1=C(O)[N+]2([O-])Oc3ccc(-c4c(O)c(O)c(-c5ccc(O)cc5)c(OC(C)=O)c4OC(C)=O)cc3O[C@]2([C@@H](C)CC)C(=O)N1OC |
| InChI | InChI=1S/C35H38N2O13/c1-8-17(3)28-33(43)37(45)35(18(4)9-2,34(44)36(28)46-7)49-25-16-22(12-15-24(25)50-37)27-30(42)29(41)26(21-10-13-23(40)14-11-21)31(47-19(5)38)32(27)48-20(6)39/h10-18,40-43H,8-9H2,1-7H3/t17-,18-,35+,37?/m0/s1 |
| InChIKey | KCXPCPJNZYKYRZ-WVVBHBOESA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Hydnellum suaveolens (ncbitaxon:524030) | fruit body (BTO:0000487) | PubMed (16755070) | Fresh fruit body |
| Hydnellum geogerirum (ncbitaxon:68815) | fruit body (BTO:0000487) | PubMed (16755070) | Fresh fruit body |
| Sarcodon scabrosus (ncbitaxon:178525) | - | Article (Z NATURFORSCH,2005,60B,565) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Sarcodonin-delta (CHEBI:66174) has role metabolite (CHEBI:25212) |
| Sarcodonin-delta (CHEBI:66174) is a biphenyls (CHEBI:22888) |
| Synonyms | Source |
|---|---|
| [3-[(5R,11aR)-3,11a-bis[(2S)-butan-2-yl]-4-hydroxy-2-methoxy-5-oxido-1-oxopyrazino[1,2-b][1,4,2]benzodioxazin-5-ium-9-yl]-2-acetyloxy-4,5-dihydroxy-6-(4-hydroxyphenyl)phenyl] acetate | ChEBI |
| Hydnellin A | ChEBI |
| Citations |
|---|