EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H14O5 |
| Net Charge | 0 |
| Average Mass | 286.283 |
| Monoisotopic Mass | 286.08412 |
| SMILES | COc1cc(O)ccc1C(=O)/C=C/c1ccc(O)c(O)c1 |
| InChI | InChI=1S/C16H14O5/c1-21-16-9-11(17)4-5-12(16)13(18)6-2-10-3-7-14(19)15(20)8-10/h2-9,17,19-20H,1H3/b6-2+ |
| InChIKey | JVGNTXGHBHMJDO-QHHAFSJGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Caesalpinia sappan (ncbitaxon:483143) | heartwood (PO:0004512) | PubMed (19420770) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | anti-allergic agent A drug used to treat allergic reactions. anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sappanchalcone (CHEBI:66172) has functional parent trans-chalcone (CHEBI:48965) |
| sappanchalcone (CHEBI:66172) has role anti-allergic agent (CHEBI:50857) |
| sappanchalcone (CHEBI:66172) has role anti-inflammatory agent (CHEBI:67079) |
| sappanchalcone (CHEBI:66172) has role antioxidant (CHEBI:22586) |
| sappanchalcone (CHEBI:66172) has role metabolite (CHEBI:25212) |
| sappanchalcone (CHEBI:66172) is a catechols (CHEBI:33566) |
| sappanchalcone (CHEBI:66172) is a chalcones (CHEBI:23086) |
| sappanchalcone (CHEBI:66172) is a monomethoxybenzene (CHEBI:25235) |
| IUPAC Name |
|---|
| (2E)-3-(3,4-dihydroxyphenyl)-1-(4-hydroxy-2-methoxyphenyl)prop-2-en-1-one |
| Synonym | Source |
|---|---|
| 3,4,4'-trihydroxy-2'-methoxychalcone | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| KR20070060715 | Patent |
| KR20120007809 | Patent |
| LMPK12120114 | LIPID MAPS |
| WO2007066928 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5968372 | Reaxys |
| CAS:94344-54-4 | ChemIDplus |
| Citations |
|---|