EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H69NO11 |
| Net Charge | 0 |
| Average Mass | 812.054 |
| Monoisotopic Mass | 811.48706 |
| SMILES | [H][C@]1([C@@]2([H])CC[C@H](C(C)(C)O)O[C@@H]2O)CC[C@@]2(C)C3=C(C[C@H](O)[C@]12C)[C@@]1(C)C[C@@H](O)[C@H](OC(=O)CC(C)(O)CC(=O)NC(Cc2ccccc2)C(=O)OC)C(C)(C)[C@]1([H])CC3 |
| InChI | InChI=1S/C46H69NO11/c1-41(2)33-17-16-29-30(22-34(49)46(8)28(19-20-45(29,46)7)27-15-18-35(42(3,4)54)57-39(27)52)44(33,6)23-32(48)38(41)58-37(51)25-43(5,55)24-36(50)47-31(40(53)56-9)21-26-13-11-10-12-14-26/h10-14,27-28,31-35,38-39,48-49,52,54-55H,15-25H2,1-9H3,(H,47,50)/t27-,28-,31?,32-,33+,34+,35-,38+,39+,43?,44-,45+,46+/m1/s1 |
| InChIKey | ZEGGEDOMPWZJBY-HACSTSGFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tricholoma saponaceum (ncbitaxon:113602) | fruit body (BTO:0000487) | PubMed (15256717) | Fresh fruit body |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| saponaceol A (CHEBI:66171) has role plant metabolite (CHEBI:76924) |
| saponaceol A (CHEBI:66171) is a methyl ester (CHEBI:25248) |
| saponaceol A (CHEBI:66171) is a secondary carboxamide (CHEBI:140325) |
| saponaceol A (CHEBI:66171) is a tetracyclic triterpenoid (CHEBI:26893) |
| saponaceol A (CHEBI:66171) is a tetrol (CHEBI:33573) |
| saponaceol A (CHEBI:66171) is a triterpenoid (CHEBI:36615) |
| IUPAC Name |
|---|
| rel-methyl N-(3-hydroxy-3-methyl-5-oxo-5-{[(2a,3b,12a,21S,24R)-2,12,21,25-tetrahydroxy-21,24-epoxylanost-8-en-3-yl]oxy}pentanoyl)phenylalaninate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9893090 | Reaxys |
| Citations |
|---|