EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C49H80O17 |
| Net Charge | 0 |
| Average Mass | 941.162 |
| Monoisotopic Mass | 940.53955 |
| SMILES | [H][C@@]1(O[C@@H]2[C@@H](O)[C@H](O)[C@@H](CO)O[C@@]2([H])O[C@H]2CC[C@]3(C)[C@@]4([H])CC[C@@]5(C)[C@@]([H])([C@]6([H])C[C@@H](C=C(C)C)O[C@H]6OC)CC[C@]5(C)C4=CC[C@@]3([H])C2(C)C)O[C@H](CO[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C49H80O17/c1-22(2)18-24-19-25(42(59-9)62-24)26-12-16-49(8)28-10-11-31-46(4,5)32(14-15-47(31,6)27(28)13-17-48(26,49)7)65-45-41(38(56)34(52)29(20-50)63-45)66-44-40(58)37(55)35(53)30(64-44)21-60-43-39(57)36(54)33(51)23(3)61-43/h10,18,23-27,29-45,50-58H,11-17,19-21H2,1-9H3/t23-,24+,25-,26+,27-,29+,30+,31-,32-,33-,34+,35+,36+,37-,38-,39+,40+,41+,42+,43+,44-,45-,47+,48-,49+/m0/s1 |
| InChIKey | OCKYPFQQFWGAQA-GZIBETPZSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Sapindus mukorossi (ncbitaxon:57655) | gall (BTO:0000303) | PubMed (17827775) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | platelet aggregation inhibitor A drug or agent which antagonizes or impairs any mechanism leading to blood platelet aggregation, whether during the phases of activation and shape change or following the dense-granule release reaction and stimulation of the prostaglandin-thromboxane system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sapinmusaponin R (CHEBI:66170) has role plant metabolite (CHEBI:76924) |
| sapinmusaponin R (CHEBI:66170) has role platelet aggregation inhibitor (CHEBI:50427) |
| sapinmusaponin R (CHEBI:66170) is a oxolanes (CHEBI:26912) |
| sapinmusaponin R (CHEBI:66170) is a tirucallane triterpenoid (CHEBI:83211) |
| sapinmusaponin R (CHEBI:66170) is a trisaccharide derivative (CHEBI:63571) |
| sapinmusaponin R (CHEBI:66170) is a triterpenoid saponin (CHEBI:61778) |
| Synonyms | Source |
|---|---|
| 21α-methoxy-3β,21(R),23(S)-epoxytirucall-7,24-diene-3-O-α-L-rhamnopyranosyl-(1→6)-β-D-glucopyranosyl-(1→2)-β-D-glucopyranoside | ChEBI |
| (3β,13α,14β,20S,21R,23S)-21-methoxy-21,23-epoxylanosta-7,24-dien-3-yl 6-deoxy-α-L-mannopyranosyl-(1→6)-β-D-glucopyranosyl-(1→2)-β-D-glucopyranoside | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11171146 | Reaxys |
| Citations |
|---|