EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H26O4 |
| Net Charge | 0 |
| Average Mass | 270.369 |
| Monoisotopic Mass | 270.18311 |
| SMILES | [H][C@@]12O[C@@]1(C)C[C@@H](O)[C@H](O)/C(C)=C\C[C@@H](C(C)C)[C@H]2O |
| InChI | InChI=1S/C15H26O4/c1-8(2)10-6-5-9(3)12(17)11(16)7-15(4)14(19-15)13(10)18/h5,8,10-14,16-18H,6-7H2,1-4H3/b9-5-/t10-,11+,12+,13+,14-,15-/m0/s1 |
| InChIKey | UOUMJKKOPWRYPB-QBCLFKMJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Santolina insularis (ncbitaxon:765941) | aerial part (BTO:0001658) | PubMed (15974607) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,2R,4S,5S,6R,7S)4,5-epoxygermacra-9Z-en-1,2,6-triol (CHEBI:66168) has role antineoplastic agent (CHEBI:35610) |
| (1R,2R,4S,5S,6R,7S)4,5-epoxygermacra-9Z-en-1,2,6-triol (CHEBI:66168) has role metabolite (CHEBI:25212) |
| (1R,2R,4S,5S,6R,7S)4,5-epoxygermacra-9Z-en-1,2,6-triol (CHEBI:66168) is a epoxide (CHEBI:32955) |
| (1R,2R,4S,5S,6R,7S)4,5-epoxygermacra-9Z-en-1,2,6-triol (CHEBI:66168) is a germacrane sesquiterpenoid (CHEBI:68588) |
| (1R,2R,4S,5S,6R,7S)4,5-epoxygermacra-9Z-en-1,2,6-triol (CHEBI:66168) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (1S,2R,3S,5Z,7R,8R,10S)-6,10-dimethyl-3-(propan-2-yl)-11-oxabicyclo[8.1.0]undec-5-ene-2,7,8-triol |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15769284 | Reaxys |
| Citations |
|---|