EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H28O9 |
| Net Charge | 0 |
| Average Mass | 436.457 |
| Monoisotopic Mass | 436.17333 |
| SMILES | [H][C@]12[C@@H](O)[C@H](O)[C@@]3(C)OC[C@]14[C@@]3([H])[C@@H](OC(C)=O)C(=O)O[C@]4([H])C[C@@]1([H])C(C)=CC(=O)[C@@H](O)[C@]21C |
| InChI | InChI=1S/C22H28O9/c1-8-5-11(24)17(26)20(3)10(8)6-12-22-7-29-21(4,18(27)13(25)15(20)22)16(22)14(19(28)31-12)30-9(2)23/h5,10,12-18,25-27H,6-7H2,1-4H3/t10-,12+,13+,14+,15+,16-,17+,18-,20-,21-,22+/m0/s1 |
| InChIKey | PLUUPKMBPOFNDA-JEFQDFFJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Samadera indica (ncbitaxon:459147) | stem (BTO:0001300) | PubMed (8945767) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| samaderine X (CHEBI:66162) has role antimalarial (CHEBI:38068) |
| samaderine X (CHEBI:66162) has role antineoplastic agent (CHEBI:35610) |
| samaderine X (CHEBI:66162) has role metabolite (CHEBI:25212) |
| samaderine X (CHEBI:66162) is a acetate ester (CHEBI:47622) |
| samaderine X (CHEBI:66162) is a cyclic ether (CHEBI:37407) |
| samaderine X (CHEBI:66162) is a enone (CHEBI:51689) |
| samaderine X (CHEBI:66162) is a organic heteropentacyclic compound (CHEBI:38164) |
| samaderine X (CHEBI:66162) is a quassinoid (CHEBI:72485) |
| samaderine X (CHEBI:66162) is a secondary alcohol (CHEBI:35681) |
| samaderine X (CHEBI:66162) is a secondary α-hydroxy ketone (CHEBI:2468) |
| samaderine X (CHEBI:66162) is a triol (CHEBI:27136) |
| samaderine X (CHEBI:66162) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1β,11β,12α,15β)-1,11,12-trihydroxy-2,16-dioxo-13,20-epoxypicras-3-en-15-yl acetate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7669489 | Reaxys |
| Citations |
|---|