EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24O7 |
| Net Charge | 0 |
| Average Mass | 364.394 |
| Monoisotopic Mass | 364.15220 |
| SMILES | [H][C@@]12C(=O)O[C@@]3([H])[C@H](O)[C@@]4([H])[C@@]1(CO[C@@]23C)C(=O)C[C@@]1([H])C(C)=C[C@H](O)[C@@H](O)[C@]41C |
| InChI | InChI=1S/C19H24O7/c1-7-4-9(20)14(23)17(2)8(7)5-10(21)19-6-25-18(3)13(19)16(24)26-15(18)11(22)12(17)19/h4,8-9,11-15,20,22-23H,5-6H2,1-3H3/t8-,9-,11+,12+,13-,14+,15-,17-,18-,19+/m0/s1 |
| InChIKey | PDGZDUYWUXJXRO-ANPVQLFHSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Samadera indica (ncbitaxon:459147) | stem (BTO:0001300) | PubMed (8945767) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| samaderine C (CHEBI:66160) has role antineoplastic agent (CHEBI:35610) |
| samaderine C (CHEBI:66160) has role metabolite (CHEBI:25212) |
| samaderine C (CHEBI:66160) is a bridged compound (CHEBI:35990) |
| samaderine C (CHEBI:66160) is a cyclic ether (CHEBI:37407) |
| samaderine C (CHEBI:66160) is a cyclic ketone (CHEBI:3992) |
| samaderine C (CHEBI:66160) is a lactone (CHEBI:25000) |
| samaderine C (CHEBI:66160) is a organic heteropentacyclic compound (CHEBI:38164) |
| samaderine C (CHEBI:66160) is a quassinoid (CHEBI:72485) |
| samaderine C (CHEBI:66160) is a secondary alcohol (CHEBI:35681) |
| samaderine C (CHEBI:66160) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (1R,2S,5R,5aR,7aS,10S,11S,11aS,11bR,14S)-1,10,11-trihydroxy-8,11a,14-trimethyl-7,7a,10,11,11a,11b-hexahydro-2H-2,5,5a-(methanetriyloxymethano)naphtho[1,2-d]oxepine-4,6(1H,5H)-dione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6667268 | Reaxys |
| Citations |
|---|