EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H22O7 |
| Net Charge | 0 |
| Average Mass | 362.378 |
| Monoisotopic Mass | 362.13655 |
| SMILES | [H][C@@]12C(=O)O[C@@]3([H])[C@H](O)[C@@]4([H])[C@@]1(CO[C@@]23C)C(=O)C[C@@]1([H])C(C)=CC(=O)[C@@H](O)[C@]41C |
| InChI | InChI=1S/C19H22O7/c1-7-4-9(20)14(23)17(2)8(7)5-10(21)19-6-25-18(3)13(19)16(24)26-15(18)11(22)12(17)19/h4,8,11-15,22-23H,5-6H2,1-3H3/t8-,11+,12+,13-,14+,15-,17-,18-,19+/m0/s1 |
| InChIKey | CVLVYBSPYHCGGU-VQXUUFQGSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Samadera indica (ncbitaxon:459147) | stem (BTO:0001300) | PubMed (8945767) | |
| Samadera madagascariensis (IPNI:814072-1) | leaf (BTO:0000713) | PubMed (16253298) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antimalarial A drug used in the treatment of malaria. Antimalarials are usually classified on the basis of their action against Plasmodia at different stages in their life cycle in the human. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| samaderine B (CHEBI:66159) has role antimalarial (CHEBI:38068) |
| samaderine B (CHEBI:66159) has role antineoplastic agent (CHEBI:35610) |
| samaderine B (CHEBI:66159) has role metabolite (CHEBI:25212) |
| samaderine B (CHEBI:66159) is a bridged compound (CHEBI:35990) |
| samaderine B (CHEBI:66159) is a cyclic ether (CHEBI:37407) |
| samaderine B (CHEBI:66159) is a enone (CHEBI:51689) |
| samaderine B (CHEBI:66159) is a lactone (CHEBI:25000) |
| samaderine B (CHEBI:66159) is a organic heteropentacyclic compound (CHEBI:38164) |
| samaderine B (CHEBI:66159) is a quassinoid (CHEBI:72485) |
| samaderine B (CHEBI:66159) is a secondary alcohol (CHEBI:35681) |
| samaderine B (CHEBI:66159) is a secondary α-hydroxy ketone (CHEBI:2468) |
| IUPAC Name |
|---|
| (1R,2S,5R,5aR,7aS,11S,11aS,11bR,14S)-1,11-dihydroxy-8,11a,14-trimethyl-1,7,7a,11,11a,11b-hexahydro-2H-2,5,5a-(methanetriyloxymethano)naphtho[1,2-d]oxepine-4,6,10(5H)-trione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6667806 | Reaxys |
| Citations |
|---|