EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O5 |
| Net Charge | 0 |
| Average Mass | 488.709 |
| Monoisotopic Mass | 488.35017 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@@]1(O)C(C)(C)[C@@H](O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H48O5/c1-17-10-11-29(24(33)34)14-12-26(5)19(22(29)18(17)2)8-9-21-27(26,6)13-15-30(35)25(3,4)23(32)20(31)16-28(21,30)7/h8,17-18,20-23,31-32,35H,9-16H2,1-7H3,(H,33,34)/t17-,18+,20-,21+,22+,23+,26-,27-,28-,29+,30-/m1/s1 |
| InChIKey | XJHLRTKILMVGFI-WRKHHLQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia santolinifolia (ncbitaxon:392689) | whole plant (BTO:0001461) | PubMed (16596990) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salvin A (CHEBI:66155) has parent hydride ursane (CHEBI:35711) |
| salvin A (CHEBI:66155) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| salvin A (CHEBI:66155) has role metabolite (CHEBI:25212) |
| salvin A (CHEBI:66155) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| salvin A (CHEBI:66155) is a pentacyclic triterpenoid (CHEBI:25872) |
| salvin A (CHEBI:66155) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (2α,3β)-2,3,5-trihydroxyurs-12-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22496444 | Reaxys |
| Citations |
|---|