EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H48O5 |
| Net Charge | 0 |
| Average Mass | 488.709 |
| Monoisotopic Mass | 488.35017 |
| SMILES | [H][C@]12CC=C3[C@@](C)(CC[C@@]4(C(=O)O)CC[C@@H](C)[C@H](C)[C@@]34[H])[C@]1(C)CC[C@@]1(O)C(C)(C)[C@@H](O)[C@H](O)C[C@]21C |
| InChI | InChI=1S/C30H48O5/c1-17-10-11-29(24(33)34)14-12-26(5)19(22(29)18(17)2)8-9-21-27(26,6)13-15-30(35)25(3,4)23(32)20(31)16-28(21,30)7/h8,17-18,20-23,31-32,35H,9-16H2,1-7H3,(H,33,34)/t17-,18+,20-,21+,22+,23+,26-,27-,28-,29+,30-/m1/s1 |
| InChIKey | XJHLRTKILMVGFI-WRKHHLQNSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia santolinifolia (ncbitaxon:392689) | whole plant (BTO:0001461) | PubMed (16596990) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.1.1.8 (cholinesterase) inhibitor An EC 3.1.1.* (carboxylic ester hydrolase) inhibitor that interferes with the action of cholinesterase (EC 3.1.1.8). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salvin A (CHEBI:66155) has parent hydride ursane (CHEBI:35711) |
| salvin A (CHEBI:66155) has role EC 3.1.1.8 (cholinesterase) inhibitor (CHEBI:37733) |
| salvin A (CHEBI:66155) has role metabolite (CHEBI:25212) |
| salvin A (CHEBI:66155) is a hydroxy monocarboxylic acid (CHEBI:35868) |
| salvin A (CHEBI:66155) is a pentacyclic triterpenoid (CHEBI:25872) |
| salvin A (CHEBI:66155) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (2α,3β)-2,3,5-trihydroxyurs-12-en-28-oic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:22496444 | Reaxys |
| Citations |
|---|