EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H14O5 |
| Net Charge | 0 |
| Average Mass | 334.327 |
| Monoisotopic Mass | 334.08412 |
| SMILES | [H][C@@]12C=C3C(=O)OC[C@]34[C@]3(C=CC5=C([C@@H](c6ccoc6)OC5=O)[C@]34C1)C2 |
| InChI | InChI=1S/C20H14O5/c21-16-12-1-3-18-6-10-5-13-17(22)24-9-20(13,18)19(18,7-10)14(12)15(25-16)11-2-4-23-8-11/h1-5,8,10,15H,6-7,9H2/t10-,15+,18+,19+,20+/m0/s1 |
| InChIKey | ZWSRRRRYHMMHQC-MDOCMBDYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Salvia leucantha (ncbitaxon:933138) | aerial part (BTO:0001658) | PubMed (18788744) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| salvileucalin B (CHEBI:66154) has role antineoplastic agent (CHEBI:35610) |
| salvileucalin B (CHEBI:66154) has role metabolite (CHEBI:25212) |
| salvileucalin B (CHEBI:66154) is a bridged compound (CHEBI:35990) |
| salvileucalin B (CHEBI:66154) is a diterpenoid (CHEBI:23849) |
| salvileucalin B (CHEBI:66154) is a furans (CHEBI:24129) |
| salvileucalin B (CHEBI:66154) is a γ-lactone (CHEBI:37581) |
| Synonym | Source |
|---|---|
| (+)-salvileucalin B | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19033817 | Reaxys |
| Citations |
|---|