EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20O7 |
| Net Charge | 0 |
| Average Mass | 384.384 |
| Monoisotopic Mass | 384.12090 |
| SMILES | O=C(OC[C@]1(O)C=C[C@H](OC(=O)c2ccccc2)[C@@H](O)[C@@H]1O)c1ccccc1 |
| InChI | InChI=1S/C21H20O7/c22-17-16(28-20(25)15-9-5-2-6-10-15)11-12-21(26,18(17)23)13-27-19(24)14-7-3-1-4-8-14/h1-12,16-18,22-23,26H,13H2/t16-,17+,18-,21+/m0/s1 |
| InChIKey | PCFGXGDGOLIQTE-TWFHAPMSSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Uvaria kweichowensis (IPNI:75758-1) | leaf (BTO:0000713) | PubMed (15997144) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kweichowenol B (CHEBI:66152) has parent hydride cyclohexene (CHEBI:36404) |
| kweichowenol B (CHEBI:66152) has role antineoplastic agent (CHEBI:35610) |
| kweichowenol B (CHEBI:66152) has role metabolite (CHEBI:25212) |
| kweichowenol B (CHEBI:66152) is a benzoate ester (CHEBI:36054) |
| kweichowenol B (CHEBI:66152) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| (1S,4R,5S,6S)-4-[(benzoyloxy)methyl]-4,5,6-trihydroxycyclohex-2-en-1-yl benzoate |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10196166 | Reaxys |