EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H28O5 |
| Net Charge | 0 |
| Average Mass | 360.450 |
| Monoisotopic Mass | 360.19367 |
| SMILES | [H][C@@]12C[C@]3(O)O[C@@]1(CCCC2(C)C)CC1=C3C(=O)C(C(C)C)=C(OC)C1=O |
| InChI | InChI=1S/C21H28O5/c1-11(2)14-17(23)15-12(16(22)18(14)25-5)9-20-8-6-7-19(3,4)13(20)10-21(15,24)26-20/h11,13,24H,6-10H2,1-5H3/t13-,20-,21-/m0/s1 |
| InChIKey | DUWHKUPNNGPNFK-ZEWGMFERSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Dracocephalum komarovii (IPNI:446449-1) | whole plant (BTO:0001461) | PubMed (12542361) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| Application: | trypanocidal drug A drug used to treat or prevent infections caused by protozoal organisms belonging to the suborder Trypanosomatida. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| komaroviquinone (CHEBI:66148) has role metabolite (CHEBI:25212) |
| komaroviquinone (CHEBI:66148) has role trypanocidal drug (CHEBI:36335) |
| komaroviquinone (CHEBI:66148) is a p-quinones (CHEBI:25830) |
| komaroviquinone (CHEBI:66148) is a bridged compound (CHEBI:35990) |
| komaroviquinone (CHEBI:66148) is a lactol (CHEBI:38131) |
| komaroviquinone (CHEBI:66148) is a tetracyclic diterpenoid (CHEBI:52557) |
| IUPAC Name |
|---|
| (4aS,10S,11aS)-10-hydroxy-7-methoxy-1,1-dimethyl-8-(propan-2-yl)-1,2,3,4,5,10,11,11a-octahydro-4a,10-epoxydibenzo[a,d][7]annulene-6,9-dione |
| Synonym | Source |
|---|---|
| (+)-komaroviquinone | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:9438711 | Reaxys |
| Citations |
|---|