EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H53N3O12 |
| Net Charge | 0 |
| Average Mass | 719.829 |
| Monoisotopic Mass | 719.36292 |
| SMILES | [H][C@@]1([C@@H](C)CC)OC(=O)[C@H](C)OC(=O)[C@@H](NC(=O)c2cccc(N)c2O)[C@@H](C)OC(=O)[C@H](CC(C)C)OC(=O)C(C)(C)C(=O)[C@H](CC(C)C)NC1=O |
| InChI | InChI=1S/C36H53N3O12/c1-11-19(6)28-31(43)38-24(15-17(2)3)29(41)36(9,10)35(47)50-25(16-18(4)5)33(45)48-20(7)26(34(46)49-21(8)32(44)51-28)39-30(42)22-13-12-14-23(37)27(22)40/h12-14,17-21,24-26,28,40H,11,15-16,37H2,1-10H3,(H,38,43)(H,39,42)/t19-,20+,21-,24-,25-,26-,28-/m0/s1 |
| InChIKey | NHGPGFIEZTYBBN-FBIIVLIJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kitasatospora (ncbitaxon:2063) | - | PubMed (17608530) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kitastatin 1 (CHEBI:66146) has role antineoplastic agent (CHEBI:35610) |
| kitastatin 1 (CHEBI:66146) has role metabolite (CHEBI:25212) |
| kitastatin 1 (CHEBI:66146) is a benzamides (CHEBI:22702) |
| kitastatin 1 (CHEBI:66146) is a cyclodepsipeptide (CHEBI:35213) |
| kitastatin 1 (CHEBI:66146) is a phenols (CHEBI:33853) |
| kitastatin 1 (CHEBI:66146) is a primary arylamine (CHEBI:50471) |
| IUPAC Name |
|---|
| 3-amino-N-[(2S,5S,8S,13S,16R,17S)-5-[(2S)-butan-2-yl]-2,10,10,16-tetramethyl-8,13-bis(2-methylpropyl)-3,6,9,11,14,18-hexaoxo-1,4,12,15-tetraoxa-7-azacyclooctadecan-17-yl]-2-hydroxybenzamide |
| Manual Xrefs | Databases |
|---|---|
| US2010197570 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11184598 | Reaxys |
| Citations |
|---|