EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H73BrN8O11 |
| Net Charge | 0 |
| Average Mass | 994.039 |
| Monoisotopic Mass | 992.45822 |
| SMILES | [H][C@@]12CC[C@@H](O)N(C1=O)[C@@]([H])([C@H](C)CC)C(=O)N(C)[C@@H](Cc1ccc(OC)c(Br)c1)C(=O)N[C@@H](C(C)C)C(=O)O[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)CCC)C(C)C)C(=O)N[C@@H](CCCCN)C(=O)N2 |
| InChI | InChI=1S/C46H73BrN8O11/c1-11-15-34(56)51-36(24(3)4)42(60)53-38-27(8)66-46(64)37(25(5)6)52-41(59)32(23-28-17-19-33(65-10)29(47)22-28)54(9)45(63)39(26(7)12-2)55-35(57)20-18-31(44(55)62)50-40(58)30(49-43(38)61)16-13-14-21-48/h17,19,22,24-27,30-32,35-39,57H,11-16,18,20-21,23,48H2,1-10H3,(H,49,61)(H,50,58)(H,51,56)(H,52,59)(H,53,60)/t26-,27-,30+,31-,32+,35-,36+,37+,38+,39+/m1/s1 |
| InChIKey | BESCRSMOIPNLKZ-BZKFFGQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya (ncbitaxon:28073) | - | PubMed (18693761) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | serine protease inhibitor Any protease inhibitor that restricts the action of a serine protease. EC 3.4.21.4 (trypsin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of trypsin (EC 3.4.21.4). metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kempopeptin B (CHEBI:66143) has role EC 3.4.21.4 (trypsin) inhibitor (CHEBI:76940) |
| kempopeptin B (CHEBI:66143) has role metabolite (CHEBI:25212) |
| kempopeptin B (CHEBI:66143) has role serine protease inhibitor (CHEBI:64926) |
| kempopeptin B (CHEBI:66143) is a cyclodepsipeptide (CHEBI:35213) |
| kempopeptin B (CHEBI:66143) is a macrocycle (CHEBI:51026) |
| kempopeptin B (CHEBI:66143) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| N-[(2S,5S,8S,11R,12S,15S,18R,21R)-15-(4-aminobutyl)-5-(3-bromo-4-methoxybenzyl)-2-[(2R)-butan-2-yl]-21-hydroxy-4,11-dimethyl-3,6,9,13,16,22-hexaoxo-8-(propan-2-yl)-10-oxa-1,4,7,14,17-pentaazabicyclo[16.3.1]docos-12-yl]-N2-butanoyl-L-valinamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19205156 | Reaxys |
| Citations |
|---|