EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C46H73BrN8O11 |
| Net Charge | 0 |
| Average Mass | 994.039 |
| Monoisotopic Mass | 992.45822 |
| SMILES | [H][C@@]12CC[C@@H](O)N(C1=O)[C@@]([H])([C@H](C)CC)C(=O)N(C)[C@@H](Cc1ccc(OC)c(Br)c1)C(=O)N[C@@H](C(C)C)C(=O)O[C@H](C)[C@H](NC(=O)[C@@H](NC(=O)CCC)C(C)C)C(=O)N[C@@H](CCCCN)C(=O)N2 |
| InChI | InChI=1S/C46H73BrN8O11/c1-11-15-34(56)51-36(24(3)4)42(60)53-38-27(8)66-46(64)37(25(5)6)52-41(59)32(23-28-17-19-33(65-10)29(47)22-28)54(9)45(63)39(26(7)12-2)55-35(57)20-18-31(44(55)62)50-40(58)30(49-43(38)61)16-13-14-21-48/h17,19,22,24-27,30-32,35-39,57H,11-16,18,20-21,23,48H2,1-10H3,(H,49,61)(H,50,58)(H,51,56)(H,52,59)(H,53,60)/t26-,27-,30+,31-,32+,35-,36+,37+,38+,39+/m1/s1 |
| InChIKey | BESCRSMOIPNLKZ-BZKFFGQOSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Lyngbya (ncbitaxon:28073) | - | PubMed (18693761) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. EC 3.4.21.4 (trypsin) inhibitor An EC 3.4.21.* (serine endopeptidase) inhibitor that interferes with the action of trypsin (EC 3.4.21.4). serine protease inhibitor Any protease inhibitor that restricts the action of a serine protease. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kempopeptin B (CHEBI:66143) has role EC 3.4.21.4 (trypsin) inhibitor (CHEBI:76940) |
| kempopeptin B (CHEBI:66143) has role metabolite (CHEBI:25212) |
| kempopeptin B (CHEBI:66143) has role serine protease inhibitor (CHEBI:64926) |
| kempopeptin B (CHEBI:66143) is a cyclodepsipeptide (CHEBI:35213) |
| kempopeptin B (CHEBI:66143) is a macrocycle (CHEBI:51026) |
| kempopeptin B (CHEBI:66143) is a organobromine compound (CHEBI:37141) |
| IUPAC Name |
|---|
| N-[(2S,5S,8S,11R,12S,15S,18R,21R)-15-(4-aminobutyl)-5-(3-bromo-4-methoxybenzyl)-2-[(2R)-butan-2-yl]-21-hydroxy-4,11-dimethyl-3,6,9,13,16,22-hexaoxo-8-(propan-2-yl)-10-oxa-1,4,7,14,17-pentaazabicyclo[16.3.1]docos-12-yl]-N2-butanoyl-L-valinamide |
| Registry Numbers | Sources |
|---|---|
| Reaxys:19205156 | Reaxys |
| Citations |
|---|