EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20O6 |
| Net Charge | 0 |
| Average Mass | 284.308 |
| Monoisotopic Mass | 284.12599 |
| SMILES | COc1ccc(CC(O)C(OC(C)=O)C(O)CO)cc1 |
| InChI | InChI=1S/C14H20O6/c1-9(16)20-14(13(18)8-15)12(17)7-10-3-5-11(19-2)6-4-10/h3-6,12-15,17-18H,7-8H2,1-2H3 |
| InChIKey | JATBUOZGJQJSGA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Pseudomonas putida (ncbitaxon:303) | - | PubMed (8626242) | Co-cultured with pseudomonas fluorescens Strain: SS 3(CCM4430) |
| Pseudomonas fluorescens (ncbitaxon:294) | - | PubMed (8626242) | Co-cultured with pseudomonas putida Strain: SS 3(CCM4430) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. anti-HSV-1 agent An anti-HSV agent agent that destroys or inhibits the replication of herpes simplex virus-1. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| karalicin (CHEBI:66140) has role anti-HSV-1 agent (CHEBI:64953) |
| karalicin (CHEBI:66140) has role metabolite (CHEBI:25212) |
| karalicin (CHEBI:66140) is a acetate ester (CHEBI:47622) |
| karalicin (CHEBI:66140) is a monomethoxybenzene (CHEBI:25235) |
| karalicin (CHEBI:66140) is a pentitol derivative (CHEBI:63434) |
| karalicin (CHEBI:66140) is a triol (CHEBI:27136) |
| IUPAC Name |
|---|
| 3-O-acetyl-1-deoxy-1-(4-methoxyphenyl)pentitol |
| Synonym | Source |
|---|---|
| [1,2,4-trihydroxy-5-(4-methoxyphenyl)pentan-3-yl] acetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7816467 | Reaxys |
| Citations |
|---|