EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H46N2O7 |
| Net Charge | 0 |
| Average Mass | 534.694 |
| Monoisotopic Mass | 534.33050 |
| SMILES | C=C(CC/C=C\C=C\CC(C)CC(=O)CC(O)CNC(=O)CC(C)OC(N)=O)CC(C)C/C(C)=C/C(=O)O |
| InChI | InChI=1S/C29H46N2O7/c1-20(13-22(3)14-23(4)16-28(35)36)11-9-7-6-8-10-12-21(2)15-25(32)18-26(33)19-31-27(34)17-24(5)38-29(30)37/h6-8,10,16,21-22,24,26,33H,1,9,11-15,17-19H2,2-5H3,(H2,30,37)(H,31,34)(H,35,36)/b7-6-,10-8+,23-16+ |
| InChIKey | VWVAAKIWHSCMIW-YHKKGOIFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Alcaligenes sp. (ncbitaxon:512) | - | PubMed (8621352) | Strain: YL 02632S |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kalimantacin C (CHEBI:66137) has role antibacterial agent (CHEBI:33282) |
| kalimantacin C (CHEBI:66137) has role antimicrobial agent (CHEBI:33281) |
| kalimantacin C (CHEBI:66137) has role bacterial metabolite (CHEBI:76969) |
| kalimantacin C (CHEBI:66137) is a carbamate ester (CHEBI:23003) |
| kalimantacin C (CHEBI:66137) is a fatty acid derivative (CHEBI:61697) |
| kalimantacin C (CHEBI:66137) is a monocarboxylic acid (CHEBI:25384) |
| kalimantacin C (CHEBI:66137) is a monocarboxylic acid amide (CHEBI:29347) |
| IUPAC Name |
|---|
| (2E,10Z,12E)-20-{[3-(carbamoyloxy)butanoyl]amino}-19-hydroxy-3,5,15-trimethyl-7-methylidene-17-oxoicosa-2,10,12-trienoic acid |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7523170 | Reaxys |
| Citations |
|---|