EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H32O14 |
| Net Charge | 0 |
| Average Mass | 724.671 |
| Monoisotopic Mass | 724.17921 |
| SMILES | C[C@@H]1O[C@@H](Oc2cc(O)c3c(=O)c(O)c(-c4ccc(O)cc4)oc3c2)[C@H](OC(=O)/C=C/c2ccc(O)cc2)[C@H](OC(=O)/C=C/c2ccc(O)cc2)[C@H]1O |
| InChI | InChI=1S/C39H32O14/c1-20-33(46)37(52-30(44)16-6-21-2-10-24(40)11-3-21)38(53-31(45)17-7-22-4-12-25(41)13-5-22)39(49-20)50-27-18-28(43)32-29(19-27)51-36(35(48)34(32)47)23-8-14-26(42)15-9-23/h2-20,33,37-43,46,48H,1H3/b16-6+,17-7+/t20-,33-,37+,38+,39-/m0/s1 |
| InChIKey | MCRKSHUHZRIUDW-UHXFTNJJSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Tetrapanax papyriferus (ncbitaxon:46417) | |||
| fruit (BTO:0000486) | PubMed (16378372) | ||
| flower (BTO:0000469) | PubMed (16378372) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferol 7-O-(2,3-di-E-p-coumaroyl-α-L-rhamnopyranoside) (CHEBI:66133) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| kaempferol 7-O-(2,3-di-E-p-coumaroyl-α-L-rhamnopyranoside) (CHEBI:66133) has role antineoplastic agent (CHEBI:35610) |
| kaempferol 7-O-(2,3-di-E-p-coumaroyl-α-L-rhamnopyranoside) (CHEBI:66133) has role metabolite (CHEBI:25212) |
| kaempferol 7-O-(2,3-di-E-p-coumaroyl-α-L-rhamnopyranoside) (CHEBI:66133) is a cinnamate ester (CHEBI:36087) |
| kaempferol 7-O-(2,3-di-E-p-coumaroyl-α-L-rhamnopyranoside) (CHEBI:66133) is a glycosyloxyflavone (CHEBI:50018) |
| kaempferol 7-O-(2,3-di-E-p-coumaroyl-α-L-rhamnopyranoside) (CHEBI:66133) is a monosaccharide derivative (CHEBI:63367) |
| IUPAC Name |
|---|
| 3,5-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-7-yl 6-deoxy-2,3-bis-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-α-L-mannopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:15775334 | Reaxys |
| Citations |
|---|