EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H36O17 |
| Net Charge | 0 |
| Average Mass | 740.667 |
| Monoisotopic Mass | 740.19525 |
| SMILES | [H][C@@]1(O[C@H]2[C@H](Oc3c(-c4ccc(O)cc4)oc4cc(O)cc(O)c4c3=O)O[C@@H](C)[C@H](O)[C@H]2O)O[C@H](COC(=O)/C=C/c2ccc(O)cc2)[C@@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C36H36O17/c1-15-26(42)30(46)34(53-35-31(47)29(45)27(43)23(51-35)14-48-24(41)11-4-16-2-7-18(37)8-3-16)36(49-15)52-33-28(44)25-21(40)12-20(39)13-22(25)50-32(33)17-5-9-19(38)10-6-17/h2-13,15,23,26-27,29-31,34-40,42-43,45-47H,14H2,1H3/b11-4+/t15-,23+,26-,27+,29-,30+,31+,34+,35-,36-/m0/s1 |
| InChIKey | KAJMZANRKFVVKV-RGXKZFLBSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Ginkgo biloba (ncbitaxon:3311) | leaf (BTO:0000713) | PubMed (11738417) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kaempferol 3-O-α-L-[6'''-p-coumaroyl-β-D-glucopyranosyl-(1→2)-rhamnopyranoside] (CHEBI:66131) has functional parent trans-4-coumaric acid (CHEBI:32374) |
| kaempferol 3-O-α-L-[6'''-p-coumaroyl-β-D-glucopyranosyl-(1→2)-rhamnopyranoside] (CHEBI:66131) has role antioxidant (CHEBI:22586) |
| kaempferol 3-O-α-L-[6'''-p-coumaroyl-β-D-glucopyranosyl-(1→2)-rhamnopyranoside] (CHEBI:66131) has role plant metabolite (CHEBI:76924) |
| kaempferol 3-O-α-L-[6'''-p-coumaroyl-β-D-glucopyranosyl-(1→2)-rhamnopyranoside] (CHEBI:66131) is a cinnamate ester (CHEBI:36087) |
| kaempferol 3-O-α-L-[6'''-p-coumaroyl-β-D-glucopyranosyl-(1→2)-rhamnopyranoside] (CHEBI:66131) is a disaccharide derivative (CHEBI:63353) |
| kaempferol 3-O-α-L-[6'''-p-coumaroyl-β-D-glucopyranosyl-(1→2)-rhamnopyranoside] (CHEBI:66131) is a glycosyloxyflavone (CHEBI:50018) |
| IUPAC Name |
|---|
| 5,7-dihydroxy-2-(4-hydroxyphenyl)-4-oxo-4H-chromen-3-yl 6-deoxy-2-O-{6-O-[(2E)-3-(4-hydroxyphenyl)prop-2-enoyl]-β-D-glucopyranosyl}-α-L-mannopyranoside |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5372831 | Reaxys |
| Citations |
|---|