EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H42O5 |
| Net Charge | 0 |
| Average Mass | 482.661 |
| Monoisotopic Mass | 482.30322 |
| SMILES | [H][C@@]12CC[C@@]3([H])C(C)(C)OC(=O)C=C[C@@]34C[C@@]14CC[C@]1(C)[C@@]([H])([C@@](C)(O)[C@@]3([H])CC=C(C)C(=O)O3)CC[C@@]21C |
| InChI | InChI=1S/C30H42O5/c1-18-7-10-22(34-24(18)32)28(6,33)20-11-13-26(4)21-9-8-19-25(2,3)35-23(31)12-14-29(19)17-30(21,29)16-15-27(20,26)5/h7,12,14,19-22,33H,8-11,13,15-17H2,1-6H3/t19-,20-,21-,22+,26-,27+,28+,29+,30-/m0/s1 |
| InChIKey | FSLAFDXATUXTAG-JHKRTFPPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura philippinensis (IPNI:554591-1) | |||
| stem (BTO:0001300) | PubMed (16018647) | ||
| leaf (BTO:0000713) | PubMed (16018647) |
| Roles Classification |
|---|
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kadsuphilactone B (CHEBI:66130) has role anti-HBV agent (CHEBI:64951) |
| kadsuphilactone B (CHEBI:66130) has role metabolite (CHEBI:25212) |
| kadsuphilactone B (CHEBI:66130) is a pentacyclic triterpenoid (CHEBI:25872) |
| kadsuphilactone B (CHEBI:66130) is a terpene lactone (CHEBI:37668) |
| kadsuphilactone B (CHEBI:66130) is a tertiary alcohol (CHEBI:26878) |
| kadsuphilactone B (CHEBI:66130) is a δ-lactone (CHEBI:18946) |
| IUPAC Name |
|---|
| (1S,3aS,3bS,5aR,10aS,11aS,13aR)-1-{(1R)-1-hydroxy-1-[(2R)-5-methyl-6-oxo-3,6-dihydro-2H-pyran-2-yl]ethyl}-3a,6,6,13a-tetramethyl-1,2,3,3a,3b,4,5,5a,6,12,13,13a-dodecahydro-8H-cyclopenta[5,6]cyclopropa[1,8a]naphtho[2,1-c]oxepin-8-one |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10132920 | Reaxys |
| Citations |
|---|