EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H36O6 |
| Net Charge | 0 |
| Average Mass | 492.612 |
| Monoisotopic Mass | 492.25119 |
| SMILES | [H][C@@]12CC[C@]3([H])C(=C[C@@]1(O)C[C@@]1([H])C4=C(C(=O)C[C@@]21C)[C@H](C)[C@]1([H])OC(=O)C(C)=C[C@]1([H])C4)C=CC(=O)OC3(C)C |
| InChI | InChI=1S/C30H36O6/c1-15-10-18-11-19-21-13-30(34)12-17-6-9-24(32)36-28(3,4)20(17)7-8-23(30)29(21,5)14-22(31)25(19)16(2)26(18)35-27(15)33/h6,9-10,12,16,18,20-21,23,26,34H,7-8,11,13-14H2,1-5H3/t16-,18+,20+,21-,23-,26-,29+,30+/m0/s1 |
| InChIKey | REUCSCMILGJJCP-SCPJPNRMSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Kadsura longipedunculata (ncbitaxon:124782) | |||
| leaf (BTO:0000713) | PubMed (16235962) | ||
| stem (BTO:0001300) | PubMed (16235962) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kadlongilactone B (CHEBI:66129) has role antineoplastic agent (CHEBI:35610) |
| kadlongilactone B (CHEBI:66129) has role metabolite (CHEBI:25212) |
| kadlongilactone B (CHEBI:66129) is a enone (CHEBI:51689) |
| kadlongilactone B (CHEBI:66129) is a hexacyclic triterpenoid (CHEBI:70994) |
| kadlongilactone B (CHEBI:66129) is a terpene lactone (CHEBI:37668) |
| kadlongilactone B (CHEBI:66129) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (4aR,5S,7aR,7bS,9aR,15aS,16aR,17aS)-15a-hydroxy-2,5,7a,10,10-pentamethyl-4a,5,7,7a,7b,8,9,9a,10,15a,16,16a,17,17a-tetradecahydro-3H-oxepino[4'',3'':4',5']cyclohepta[1',2':1,2]indeno[4,5-g]chromene-3,6,12-trione |
| Registry Numbers | Sources |
|---|---|
| Reaxys:10222094 | Reaxys |
| Citations |
|---|