EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H24O4 |
| Net Charge | 0 |
| Average Mass | 328.408 |
| Monoisotopic Mass | 328.16746 |
| SMILES | COc1cc2cc(c1O)-c1cc(ccc1O)CC[C@@H](O)CCCC2 |
| InChI | InChI=1S/C20H24O4/c1-24-19-12-14-4-2-3-5-15(21)8-6-13-7-9-18(22)16(10-13)17(11-14)20(19)23/h7,9-12,15,21-23H,2-6,8H2,1H3/t15-/m0/s1 |
| InChIKey | AVDQDLSGSIPLPN-HNNXBMFYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Juglans regia (ncbitaxon:51240) | pericarp (BTO:0001017) | PubMed (18496782) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| juglanin B (CHEBI:66127) has role antineoplastic agent (CHEBI:35610) |
| juglanin B (CHEBI:66127) has role metabolite (CHEBI:25212) |
| juglanin B (CHEBI:66127) is a methoxybenzenes (CHEBI:51683) |
| juglanin B (CHEBI:66127) is a organic molecular entity (CHEBI:50860) |
| juglanin B (CHEBI:66127) is a phenols (CHEBI:33853) |
| juglanin B (CHEBI:66127) is a secondary alcohol (CHEBI:35681) |
| IUPAC Name |
|---|
| (9S)-16-methoxytricyclo[12.3.1.12,6]nonadeca-1(18),2(19),3,5,14,16-hexaene-3,9,17-triol |
| Manual Xrefs | Databases |
|---|---|
| CN101637501 | Patent |
| Citations |
|---|