EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24O5 |
| Net Charge | 0 |
| Average Mass | 356.418 |
| Monoisotopic Mass | 356.16237 |
| SMILES | COc1ccc2cc1Oc1ccc(c(O)c1OC)CCCCC(=O)CC2 |
| InChI | InChI=1S/C21H24O5/c1-24-17-11-8-14-7-10-16(22)6-4-3-5-15-9-12-18(26-19(17)13-14)21(25-2)20(15)23/h8-9,11-13,23H,3-7,10H2,1-2H3 |
| InChIKey | WQHLZXQHMPOZGL-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Juglans regia (ncbitaxon:51240) | pericarp (BTO:0001017) | PubMed (18496782) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. neuroprotective agent Any compound that can be used for the treatment of neurodegenerative disorders. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| juglanin A (CHEBI:66126) has role antineoplastic agent (CHEBI:35610) |
| juglanin A (CHEBI:66126) has role metabolite (CHEBI:25212) |
| juglanin A (CHEBI:66126) has role neuroprotective agent (CHEBI:63726) |
| juglanin A (CHEBI:66126) is a aromatic ether (CHEBI:35618) |
| juglanin A (CHEBI:66126) is a cyclic ketone (CHEBI:3992) |
| juglanin A (CHEBI:66126) is a methoxybenzenes (CHEBI:51683) |
| juglanin A (CHEBI:66126) is a phenols (CHEBI:33853) |
| IUPAC Name |
|---|
| 16-hydroxy-4,17-dimethoxy-2-oxatricyclo[13.2.2.13,7]icosa-1(17),3(20),4,6,15,18-hexaen-10-one |
| Manual Xrefs | Databases |
|---|---|
| 24721802 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:18605218 | Reaxys |
| Citations |
|---|