EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H7NO2 |
| Net Charge | 0 |
| Average Mass | 161.160 |
| Monoisotopic Mass | 161.04768 |
| SMILES | Oc1cnc2c(O)cccc2c1 |
| InChI | InChI=1S/C9H7NO2/c11-7-4-6-2-1-3-8(12)9(6)10-5-7/h1-5,11-12H |
| InChIKey | IGDFDIZIHMFYGR-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Scolopendra subspinipes (ncbitaxon:55038) | - | DOI (10.1021/np960188t) |
| Roles Classification |
|---|
| Biological Roles: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| jineol (CHEBI:66125) has role antineoplastic agent (CHEBI:35610) |
| jineol (CHEBI:66125) has role metabolite (CHEBI:25212) |
| jineol (CHEBI:66125) is a dihydroxyquinoline (CHEBI:26507) |
| jineol (CHEBI:66125) is a quinoline alkaloid (CHEBI:26509) |
| jineol (CHEBI:66125) is a quinolines (CHEBI:26513) |
| IUPAC Name |
|---|
| quinoline-3,8-diol |
| Synonym | Source |
|---|---|
| 3,8-dihydroxyquinoline | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| US5824689 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7701329 | Reaxys |
| CAS:178762-28-2 | ChemIDplus |